(9R)-tricyclo[12.3.1.12,6]nonadeca-1(17),2,4,6(19),14(18),15-hexaene-3,9,17-triol
| Internal ID | 74616345-3308-423e-8803-e1d12b23ded3 |
| Taxonomy | Phenylpropanoids and polyketides > Diarylheptanoids > Cyclic diarylheptanoids > Meta,meta-bridged biphenyls |
| IUPAC Name | (9R)-tricyclo[12.3.1.12,6]nonadeca-1(17),2,4,6(19),14(18),15-hexaene-3,9,17-triol |
| SMILES (Canonical) | C1CCC2=CC(=C(C=C2)O)C3=C(C=CC(=C3)CCC(C1)O)O |
| SMILES (Isomeric) | C1CCC2=CC(=C(C=C2)O)C3=C(C=CC(=C3)CC[C@@H](C1)O)O |
| InChI | InChI=1S/C19H22O3/c20-15-4-2-1-3-13-6-9-18(21)16(11-13)17-12-14(5-8-15)7-10-19(17)22/h6-7,9-12,15,20-22H,1-5,8H2/t15-/m1/s1 |
| InChI Key | OUMFOFAOVINTGW-OAHLLOKOSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.40 g/mol |
| Exact Mass | 298.15689456 g/mol |
| Topological Polar Surface Area (TPSA) | 60.70 Ų |
| XlogP | 4.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.72% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 95.65% | 91.49% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 90.51% | 92.94% |
| CHEMBL2581 | P07339 | Cathepsin D | 88.61% | 98.95% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 88.14% | 88.48% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.98% | 95.56% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.96% | 95.89% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 86.74% | 93.40% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.30% | 99.15% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.43% | 97.09% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.63% | 96.09% |
| CHEMBL2535 | P11166 | Glucose transporter | 83.06% | 98.75% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 82.27% | 95.93% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.15% | 89.00% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 81.69% | 83.10% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 80.80% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162946605 |
| LOTUS | LTS0136645 |
| wikiData | Q105200247 |