(9R)-5,9-dihydroxy-2,2-dimethyl-7,7,9-tris(3-methylbut-2-enyl)pyrano[3,2-b]xanthene-6,8,10-trione
| Internal ID | 982e75d9-9a3a-423d-8a43-74b4a911a730 |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthones > Pyranoxanthones |
| IUPAC Name | (9R)-5,9-dihydroxy-2,2-dimethyl-7,7,9-tris(3-methylbut-2-enyl)pyrano[3,2-b]xanthene-6,8,10-trione |
| SMILES (Canonical) | CC(=CCC1(C2=C(C(=O)C(C1=O)(CC=C(C)C)O)OC3=CC4=C(C=CC(O4)(C)C)C(=C3C2=O)O)CC=C(C)C)C |
| SMILES (Isomeric) | CC(=CC[C@@]1(C(=O)C2=C(C(=O)C3=C(C4=C(C=C3O2)OC(C=C4)(C)C)O)C(C1=O)(CC=C(C)C)CC=C(C)C)O)C |
| InChI | InChI=1S/C33H38O7/c1-18(2)9-14-32(15-10-19(3)4)25-27(35)24-23(17-22-21(26(24)34)12-13-31(7,8)40-22)39-28(25)29(36)33(38,30(32)37)16-11-20(5)6/h9-13,17,34,38H,14-16H2,1-8H3/t33-/m0/s1 |
| InChI Key | JSDUZPVYJLXUCC-XIFFEERXSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C33H38O7 |
| Molecular Weight | 546.60 g/mol |
| Exact Mass | 546.26175355 g/mol |
| Topological Polar Surface Area (TPSA) | 110.00 Ų |
| XlogP | 7.30 |
| There are no found synonyms. |
![2D Structure of (9R)-5,9-dihydroxy-2,2-dimethyl-7,7,9-tris(3-methylbut-2-enyl)pyrano[3,2-b]xanthene-6,8,10-trione](https://plantaedb.com/storage/docs/compounds/2023/11/9r-59-dihydroxy-22-dimethyl-779-tris3-methylbut-2-enylpyrano32-bxanthene-6810-trione.jpg "2D Structure of (9R)-5,9-dihydroxy-2,2-dimethyl-7,7,9-tris(3-methylbut-2-enyl)pyrano[3,2-b]xanthene-6,8,10-trione")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.17% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.88% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.37% | 98.95% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 95.65% | 94.73% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.46% | 89.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.90% | 85.14% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.67% | 86.33% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 89.03% | 85.30% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 85.83% | 89.34% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.05% | 95.56% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 83.42% | 83.10% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 83.04% | 94.42% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 82.95% | 90.24% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.46% | 100.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.31% | 99.23% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.02% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Garcinia oligantha |
| PubChem | 162866713 |
| LOTUS | LTS0205360 |
| wikiData | Q105134291 |