9H-Carbazole-3-carboxylic acid
| Internal ID | 1920b6ae-3598-40d4-9ceb-a36b9005eade |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
| IUPAC Name | 9H-carbazole-3-carboxylic acid |
| SMILES (Canonical) | C1=CC=C2C(=C1)C3=C(N2)C=CC(=C3)C(=O)O |
| SMILES (Isomeric) | C1=CC=C2C(=C1)C3=C(N2)C=CC(=C3)C(=O)O |
| InChI | InChI=1S/C13H9NO2/c15-13(16)8-5-6-12-10(7-8)9-3-1-2-4-11(9)14-12/h1-7,14H,(H,15,16) |
| InChI Key | UZRJWXGXZKPSJO-UHFFFAOYSA-N |
| Popularity | 5 references in papers |
| Molecular Formula | C13H9NO2 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.063328530 g/mol |
| Topological Polar Surface Area (TPSA) | 53.10 Ų |
| XlogP | 3.20 |
| 51035-17-7 |
| CARBAZOLE-3-CARBOXYLIC ACID |
| MFCD03152409 |
| 9H-CARBAZOLE-3-CARBOXYLICACID |
| 6-carbazolecarboxylic acid |
| Oprea1_332226 |
| SCHEMBL70283 |
| AF-399/40971738 |
| AML0032 |
| DTXSID30389976 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.15% | 91.11% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 93.96% | 94.62% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.81% | 95.56% |
| CHEMBL2535 | P11166 | Glucose transporter | 89.41% | 98.75% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 88.01% | 93.99% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 86.68% | 90.20% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 84.51% | 97.00% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 82.97% | 94.08% |
| CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 82.01% | 89.44% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.56% | 86.33% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 81.35% | 96.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.34% | 99.23% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 81.06% | 91.71% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.32% | 89.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.31% | 90.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.07% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Clausena lansium |
| Murraya koenigii |
| PubChem | 3152023 |
| LOTUS | LTS0099226 |
| wikiData | Q82186299 |