9H-(214C)pyridino[3,4-b]indole
| Internal ID | 3ef8bbcd-99cd-4be8-b3de-375f9504a55f |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Pyridoindoles > Beta carbolines |
| IUPAC Name | 9H-(214C)pyridino[3,4-b]indole |
| SMILES (Canonical) | C1=CC=C2C(=C1)C3=C(N2)C=NC=C3 |
| SMILES (Isomeric) | C1=CC=C2C(=C1)C3=C(N2)[14CH]=NC=C3 |
| InChI | InChI=1S/C11H8N2/c1-2-4-10-8(3-1)9-5-6-12-7-11(9)13-10/h1-7,13H/i7+2 |
| InChI Key | AIFRHYZBTHREPW-WGGUOBTBSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C11H8N2 |
| Molecular Weight | 170.19 g/mol |
| Exact Mass | 170.07199025 g/mol |
| Topological Polar Surface Area (TPSA) | 28.70 Ų |
| XlogP | 3.20 |
| There are no found synonyms. |
![2D Structure of 9H-(214C)pyridino[3,4-b]indole](https://plantaedb.com/storage/docs/compounds/2023/07/9h-214cpyridino34-bindole.jpg "2D Structure of 9H-(214C)pyridino[3,4-b]indole")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL1951 | P21397 | Monoamine oxidase A |
260 nM |
Ki |
via Super-PRED
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 96.26% | 94.62% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 95.28% | 98.59% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.83% | 94.45% |
| CHEMBL2292 | Q13627 | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | 90.90% | 93.24% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.34% | 91.11% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 88.70% | 85.30% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 88.19% | 96.00% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 88.17% | 88.56% |
| CHEMBL2424504 | P29375 | Lysine-specific demethylase 5A | 86.80% | 99.23% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 86.26% | 94.08% |
| CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 85.35% | 96.47% |
| CHEMBL2535 | P11166 | Glucose transporter | 84.56% | 98.75% |
| CHEMBL308 | P06493 | Cyclin-dependent kinase 1 | 84.55% | 91.73% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 83.92% | 97.00% |
| CHEMBL2002 | P12268 | Inosine-5'-monophosphate dehydrogenase 2 | 82.31% | 98.21% |
| CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 82.18% | 80.96% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 80.33% | 96.09% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 80.30% | 92.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Polygala tenuifolia |