methyl (3R,4R,4aR,6aR,6bS,8aR,12aR,14aR,14bR)-3-acetyloxy-4,6a,6b,8a,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicene-4-carboxylate
Internal ID | 620de468-baa0-4654-8712-834fc27dc0f7 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | methyl (3R,4R,4aR,6aR,6bS,8aR,12aR,14aR,14bR)-3-acetyloxy-4,6a,6b,8a,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicene-4-carboxylate |
SMILES (Canonical) | CC(=O)OC1CCC2(C(C1(C)C(=O)OC)CCC3(C2CC=C4C3(CCC5(C4CC(CC5)(C)C)C)C)C)C |
SMILES (Isomeric) | CC(=O)O[C@@H]1CC[C@]2([C@H]([C@@]1(C)C(=O)OC)CC[C@@]3([C@@H]2CC=C4[C@]3(CC[C@@]5([C@H]4CC(CC5)(C)C)C)C)C)C |
InChI | InChI=1S/C33H52O4/c1-21(34)37-26-13-14-30(5)24-11-10-22-23-20-28(2,3)16-17-29(23,4)18-19-31(22,6)32(24,7)15-12-25(30)33(26,8)27(35)36-9/h10,23-26H,11-20H2,1-9H3/t23-,24+,25+,26+,29+,30+,31+,32+,33+/m0/s1 |
InChI Key | ZULABMXYLORHKH-NTFZVIKMSA-N |
Popularity | 0 references in papers |
Molecular Formula | C33H52O4 |
Molecular Weight | 512.80 g/mol |
Exact Mass | 512.38656014 g/mol |
Topological Polar Surface Area (TPSA) | 52.60 Ų |
XlogP | 8.80 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.10% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.63% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.19% | 91.11% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 91.15% | 96.77% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 89.18% | 82.69% |
CHEMBL2581 | P07339 | Cathepsin D | 88.15% | 98.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.18% | 95.89% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 84.75% | 94.78% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.71% | 97.09% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 84.66% | 93.03% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.27% | 91.19% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.35% | 97.14% |
CHEMBL5028 | O14672 | ADAM10 | 82.08% | 97.50% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 81.54% | 91.03% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.87% | 95.56% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.49% | 92.62% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 80.18% | 97.21% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.05% | 94.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Boswellia sacra |
PubChem | 162922926 |
LOTUS | LTS0233334 |
wikiData | Q105383774 |