[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl] (1R,3aS,5aR,5bR,7aR,8R,9S,11aR,11bR,13aR,13bR)-8-(hydroxymethyl)-5a,5b,8,11a-tetramethyl-1-prop-1-en-2-yl-9-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylate
Internal ID | bcdc2c29-e791-4880-807d-2c7ebe9375bf |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Triterpene glycosides > Triterpene saponins |
IUPAC Name | [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl] (1R,3aS,5aR,5bR,7aR,8R,9S,11aR,11bR,13aR,13bR)-8-(hydroxymethyl)-5a,5b,8,11a-tetramethyl-1-prop-1-en-2-yl-9-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylate |
SMILES (Canonical) | CC(=C)C1CCC2(C1C3CCC4C5(CCC(C(C5CCC4(C3(CC2)C)C)(C)CO)OC6C(C(C(C(O6)CO)O)O)O)C)C(=O)OC7C(C(C(C(O7)COC8C(C(C(C(O8)CO)O)O)O)O)O)O |
SMILES (Isomeric) | CC(=C)[C@@H]1CC[C@]2([C@H]1[C@H]3CC[C@@H]4[C@]5(CC[C@@H]([C@@]([C@@H]5CC[C@]4([C@@]3(CC2)C)C)(C)CO)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O)C)C(=O)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O)O)O)O)O)O |
InChI | InChI=1S/C48H78O19/c1-21(2)22-9-14-48(43(61)67-42-39(60)36(57)33(54)26(65-42)19-62-40-37(58)34(55)31(52)24(17-49)63-40)16-15-46(5)23(30(22)48)7-8-28-44(3)12-11-29(45(4,20-51)27(44)10-13-47(28,46)6)66-41-38(59)35(56)32(53)25(18-50)64-41/h22-42,49-60H,1,7-20H2,2-6H3/t22-,23+,24+,25+,26+,27+,28+,29-,30+,31+,32+,33+,34-,35-,36-,37+,38+,39+,40+,41-,42-,44-,45-,46+,47+,48-/m0/s1 |
InChI Key | PIBYCTCUYUVYMR-RVBUUBKCSA-N |
Popularity | 0 references in papers |
Molecular Formula | C48H78O19 |
Molecular Weight | 959.10 g/mol |
Exact Mass | 958.51373025 g/mol |
Topological Polar Surface Area (TPSA) | 315.00 Ų |
XlogP | 1.40 |
There are no found synonyms. |
![2D Structure of [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl] (1R,3aS,5aR,5bR,7aR,8R,9S,11aR,11bR,13aR,13bR)-8-(hydroxymethyl)-5a,5b,8,11a-tetramethyl-1-prop-1-en-2-yl-9-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylate 2D Structure of [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl] (1R,3aS,5aR,5bR,7aR,8R,9S,11aR,11bR,13aR,13bR)-8-(hydroxymethyl)-5a,5b,8,11a-tetramethyl-1-prop-1-en-2-yl-9-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylate](https://plantaedb.com/storage/docs/compounds/2023/11/9f935ca0-8422-11ee-b066-d176262424a3.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.23% | 96.09% |
CHEMBL233 | P35372 | Mu opioid receptor | 92.83% | 97.93% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.82% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.39% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.90% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.34% | 94.45% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 90.12% | 92.86% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 89.87% | 91.24% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 87.91% | 95.50% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 87.71% | 96.61% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 87.09% | 92.50% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.53% | 92.94% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 86.22% | 96.38% |
CHEMBL2581 | P07339 | Cathepsin D | 85.95% | 98.95% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 85.81% | 93.04% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.44% | 86.33% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 85.34% | 82.50% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 84.71% | 100.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.34% | 100.00% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 84.27% | 94.33% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 84.07% | 89.05% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 83.75% | 97.36% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.24% | 95.89% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.15% | 96.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.94% | 89.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.94% | 99.17% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.88% | 92.62% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.79% | 95.89% |
CHEMBL237 | P41145 | Kappa opioid receptor | 82.08% | 98.10% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 80.78% | 97.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.63% | 94.00% |
CHEMBL2096618 | P11274 | Bcr/Abl fusion protein | 80.61% | 85.83% |
CHEMBL5028 | O14672 | ADAM10 | 80.57% | 97.50% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.55% | 100.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.40% | 91.19% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 80.13% | 96.77% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Lonicera bournei |
PubChem | 162987552 |
LOTUS | LTS0199941 |
wikiData | Q105209418 |