N-[(2S,3R)-1-[[2-[[(2S)-1-[[(3S,6S,9S,12S)-9,12-bis(3-amino-3-oxopropyl)-6-(1H-imidazol-2-ylmethyl)-4,7,10,13-tetraoxo-1-oxa-5,8,11-triazacyclotetradec-3-yl]amino]-1-oxopropan-2-yl]amino]-2-oxoethyl]amino]-3-hydroxy-1-oxobutan-2-yl]-11-methyldodecanamide
| Internal ID | 2bd93b86-a3d3-44ae-9b66-35247d7dfc8a |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Hybrid peptides |
| IUPAC Name | N-[(2S,3R)-1-[[2-[[(2S)-1-[[(3S,6S,9S,12S)-9,12-bis(3-amino-3-oxopropyl)-6-(1H-imidazol-2-ylmethyl)-4,7,10,13-tetraoxo-1-oxa-5,8,11-triazacyclotetradec-3-yl]amino]-1-oxopropan-2-yl]amino]-2-oxoethyl]amino]-3-hydroxy-1-oxobutan-2-yl]-11-methyldodecanamide |
| SMILES (Canonical) | CC(C)CCCCCCCCCC(=O)NC(C(C)O)C(=O)NCC(=O)NC(C)C(=O)NC1COCC(=O)C(NC(=O)C(NC(=O)C(NC1=O)CC2=NC=CN2)CCC(=O)N)CCC(=O)N |
| SMILES (Isomeric) | C[C@H]([C@@H](C(=O)NCC(=O)N[C@@H](C)C(=O)N[C@H]1COCC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC1=O)CC2=NC=CN2)CCC(=O)N)CCC(=O)N)NC(=O)CCCCCCCCCC(C)C)O |
| InChI | InChI=1S/C42H69N11O12/c1-24(2)12-10-8-6-5-7-9-11-13-35(58)53-37(26(4)54)42(64)47-21-36(59)48-25(3)38(60)52-30-22-65-23-31(55)27(14-16-32(43)56)49-39(61)28(15-17-33(44)57)50-40(62)29(51-41(30)63)20-34-45-18-19-46-34/h18-19,24-30,37,54H,5-17,20-23H2,1-4H3,(H2,43,56)(H2,44,57)(H,45,46)(H,47,64)(H,48,59)(H,49,61)(H,50,62)(H,51,63)(H,52,60)(H,53,58)/t25-,26+,27-,28-,29-,30-,37-/m0/s1 |
| InChI Key | XFMZOMIXLZCGAO-VUICESKMSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C42H69N11O12 |
| Molecular Weight | 920.10 g/mol |
| Exact Mass | 919.51271668 g/mol |
| Topological Polar Surface Area (TPSA) | 365.00 Ų |
| XlogP | -0.60 |
| Atomic LogP (AlogP) | -2.32 |
| H-Bond Acceptor | 13 |
| H-Bond Donor | 11 |
| Rotatable Bonds | 26 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.9195 | 91.95% |
| Caco-2 | - | 0.8611 | 86.11% |
| Blood Brain Barrier | - | 0.8000 | 80.00% |
| Human oral bioavailability | - | 0.6429 | 64.29% |
| Subcellular localzation | Nucleus | 0.4189 | 41.89% |
| OATP2B1 inhibitior | - | 0.8565 | 85.65% |
| OATP1B1 inhibitior | + | 0.8661 | 86.61% |
| OATP1B3 inhibitior | + | 0.9292 | 92.92% |
| MATE1 inhibitior | - | 0.8209 | 82.09% |
| OCT2 inhibitior | - | 0.9000 | 90.00% |
| BSEP inhibitior | + | 0.9656 | 96.56% |
| P-glycoprotein inhibitior | + | 0.7468 | 74.68% |
| P-glycoprotein substrate | + | 0.8748 | 87.48% |
| CYP3A4 substrate | + | 0.7119 | 71.19% |
| CYP2C9 substrate | - | 0.5885 | 58.85% |
| CYP2D6 substrate | - | 0.8401 | 84.01% |
| CYP3A4 inhibition | - | 0.8956 | 89.56% |
| CYP2C9 inhibition | - | 0.9200 | 92.00% |
| CYP2C19 inhibition | - | 0.8974 | 89.74% |
| CYP2D6 inhibition | - | 0.9233 | 92.33% |
| CYP1A2 inhibition | - | 0.9290 | 92.90% |
| CYP2C8 inhibition | + | 0.6367 | 63.67% |
| CYP inhibitory promiscuity | - | 0.9804 | 98.04% |
| UGT catelyzed | + | 0.7000 | 70.00% |
| Carcinogenicity (binary) | - | 0.8600 | 86.00% |
| Carcinogenicity (trinary) | Non-required | 0.6001 | 60.01% |
| Eye corrosion | - | 0.9850 | 98.50% |
| Eye irritation | - | 0.9004 | 90.04% |
| Skin irritation | - | 0.7659 | 76.59% |
| Skin corrosion | - | 0.9205 | 92.05% |
| Ames mutagenesis | - | 0.6700 | 67.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.4027 | 40.27% |
| Micronuclear | + | 0.7100 | 71.00% |
| Hepatotoxicity | + | 0.5555 | 55.55% |
| skin sensitisation | - | 0.8524 | 85.24% |
| Respiratory toxicity | + | 0.8333 | 83.33% |
| Reproductive toxicity | + | 0.9111 | 91.11% |
| Mitochondrial toxicity | + | 0.8500 | 85.00% |
| Nephrotoxicity | - | 0.8741 | 87.41% |
| Acute Oral Toxicity (c) | III | 0.6400 | 64.00% |
| Estrogen receptor binding | + | 0.8153 | 81.53% |
| Androgen receptor binding | + | 0.6896 | 68.96% |
| Thyroid receptor binding | + | 0.5281 | 52.81% |
| Glucocorticoid receptor binding | - | 0.4835 | 48.35% |
| Aromatase binding | + | 0.6469 | 64.69% |
| PPAR gamma | + | 0.6989 | 69.89% |
| Honey bee toxicity | - | 0.7616 | 76.16% |
| Biodegradation | - | 0.7500 | 75.00% |
| Crustacea aquatic toxicity | - | 0.5100 | 51.00% |
| Fish aquatic toxicity | - | 0.7527 | 75.27% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.94% | 83.82% |
| CHEMBL2581 | P07339 | Cathepsin D | 99.46% | 98.95% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 98.90% | 93.10% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 98.45% | 89.63% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.35% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.26% | 96.09% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 98.17% | 88.42% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.52% | 91.11% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 97.25% | 90.08% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 96.91% | 94.66% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 96.29% | 94.75% |
| CHEMBL236 | P41143 | Delta opioid receptor | 95.60% | 99.35% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.57% | 99.17% |
| CHEMBL325 | Q13547 | Histone deacetylase 1 | 95.30% | 95.92% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 94.52% | 98.05% |
| CHEMBL1829 | O15379 | Histone deacetylase 3 | 94.13% | 95.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 93.38% | 90.71% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.10% | 97.09% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 92.74% | 95.00% |
| CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 92.57% | 89.67% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 91.70% | 88.56% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.35% | 85.14% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 91.17% | 97.23% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 91.01% | 96.11% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 90.71% | 91.38% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.93% | 99.23% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 88.42% | 95.71% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 88.41% | 83.10% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 88.00% | 96.90% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 87.87% | 92.88% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.46% | 89.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 86.25% | 94.73% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 86.14% | 93.56% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.38% | 95.89% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 84.70% | 96.47% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 84.57% | 92.97% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 84.40% | 90.17% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 84.39% | 89.33% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.10% | 96.00% |
| CHEMBL2208 | P49137 | MAP kinase-activated protein kinase 2 | 82.92% | 95.20% |
| CHEMBL1075317 | P61964 | WD repeat-containing protein 5 | 82.14% | 96.33% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 82.05% | 98.33% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 81.95% | 92.98% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 81.94% | 100.00% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.71% | 100.00% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.32% | 94.33% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 80.76% | 95.56% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 80.68% | 89.34% |
| CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 80.66% | 82.86% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 80.40% | 100.00% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 80.14% | 97.64% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 80.11% | 97.29% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 44558933 |
| LOTUS | LTS0250411 |
| wikiData | Q105327115 |