4-[[16-(1-Aminoethyl)-31-(1-carboxyethyl)-22,28-bis(carboxymethyl)-4-methyl-2,6,12,15,18,21,24,27,30,33-decaoxo-13-propan-2-yl-1,5,11,14,17,20,23,26,29,32-decazatricyclo[32.4.0.07,11]octatriacontan-3-yl]amino]-3-(9-methyldec-3-enoylamino)-4-oxobutanoic acid
| Internal ID | 1aaf634e-9f68-46c8-8482-bda81eaf089a |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Oligopeptides |
| IUPAC Name | 4-[[16-(1-aminoethyl)-31-(1-carboxyethyl)-22,28-bis(carboxymethyl)-4-methyl-2,6,12,15,18,21,24,27,30,33-decaoxo-13-propan-2-yl-1,5,11,14,17,20,23,26,29,32-decazatricyclo[32.4.0.07,11]octatriacontan-3-yl]amino]-3-(9-methyldec-3-enoylamino)-4-oxobutanoic acid |
| SMILES (Canonical) | CC1C(C(=O)N2CCCCC2C(=O)NC(C(=O)NC(C(=O)NCC(=O)NC(C(=O)NCC(=O)NC(C(=O)NC(C(=O)N3CCCC3C(=O)N1)C(C)C)C(C)N)CC(=O)O)CC(=O)O)C(C)C(=O)O)NC(=O)C(CC(=O)O)NC(=O)CC=CCCCCC(C)C |
| SMILES (Isomeric) | CC1C(C(=O)N2CCCCC2C(=O)NC(C(=O)NC(C(=O)NCC(=O)NC(C(=O)NCC(=O)NC(C(=O)NC(C(=O)N3CCCC3C(=O)N1)C(C)C)C(C)N)CC(=O)O)CC(=O)O)C(C)C(=O)O)NC(=O)C(CC(=O)O)NC(=O)CC=CCCCCC(C)C |
| InChI | InChI=1S/C56H87N13O20/c1-27(2)16-11-9-8-10-12-19-37(70)61-34(24-42(77)78)49(81)67-46-31(7)60-50(82)36-18-15-21-69(36)54(86)43(28(3)4)65-53(85)45(30(6)57)64-39(72)26-59-47(79)32(22-40(73)74)62-38(71)25-58-48(80)33(23-41(75)76)63-52(84)44(29(5)56(88)89)66-51(83)35-17-13-14-20-68(35)55(46)87/h10,12,27-36,43-46H,8-9,11,13-26,57H2,1-7H3,(H,58,80)(H,59,79)(H,60,82)(H,61,70)(H,62,71)(H,63,84)(H,64,72)(H,65,85)(H,66,83)(H,67,81)(H,73,74)(H,75,76)(H,77,78)(H,88,89) |
| InChI Key | RWKODFJGLUVNKT-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C56H87N13O20 |
| Molecular Weight | 1262.40 g/mol |
| Exact Mass | 1261.61903222 g/mol |
| Topological Polar Surface Area (TPSA) | 507.00 Ų |
| XlogP | -4.00 |
| Atomic LogP (AlogP) | -4.19 |
| H-Bond Acceptor | 17 |
| H-Bond Donor | 15 |
| Rotatable Bonds | 20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | - | 0.6653 | 66.53% |
| Caco-2 | - | 0.8606 | 86.06% |
| Blood Brain Barrier | - | 0.9000 | 90.00% |
| Human oral bioavailability | - | 0.7000 | 70.00% |
| Subcellular localzation | Lysosomes | 0.4858 | 48.58% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8197 | 81.97% |
| OATP1B3 inhibitior | + | 0.9310 | 93.10% |
| MATE1 inhibitior | - | 0.9600 | 96.00% |
| OCT2 inhibitior | - | 1.0000 | 100.00% |
| BSEP inhibitior | + | 0.8902 | 89.02% |
| P-glycoprotein inhibitior | + | 0.7419 | 74.19% |
| P-glycoprotein substrate | + | 0.8610 | 86.10% |
| CYP3A4 substrate | + | 0.7210 | 72.10% |
| CYP2C9 substrate | - | 0.8090 | 80.90% |
| CYP2D6 substrate | - | 0.8185 | 81.85% |
| CYP3A4 inhibition | - | 0.9887 | 98.87% |
| CYP2C9 inhibition | - | 0.9075 | 90.75% |
| CYP2C19 inhibition | - | 0.9328 | 93.28% |
| CYP2D6 inhibition | - | 0.9481 | 94.81% |
| CYP1A2 inhibition | - | 0.9598 | 95.98% |
| CYP2C8 inhibition | + | 0.7069 | 70.69% |
| CYP inhibitory promiscuity | - | 0.9902 | 99.02% |
| UGT catelyzed | - | 0.0000 | 0.00% |
| Carcinogenicity (binary) | - | 0.9600 | 96.00% |
| Carcinogenicity (trinary) | Non-required | 0.6290 | 62.90% |
| Eye corrosion | - | 0.9860 | 98.60% |
| Eye irritation | - | 0.8965 | 89.65% |
| Skin irritation | - | 0.7486 | 74.86% |
| Skin corrosion | - | 0.9105 | 91.05% |
| Ames mutagenesis | - | 0.5054 | 50.54% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.6480 | 64.80% |
| Micronuclear | + | 0.7800 | 78.00% |
| Hepatotoxicity | - | 0.5875 | 58.75% |
| skin sensitisation | - | 0.8652 | 86.52% |
| Respiratory toxicity | + | 0.8333 | 83.33% |
| Reproductive toxicity | + | 0.8778 | 87.78% |
| Mitochondrial toxicity | + | 0.9500 | 95.00% |
| Nephrotoxicity | - | 0.6377 | 63.77% |
| Acute Oral Toxicity (c) | III | 0.5746 | 57.46% |
| Estrogen receptor binding | + | 0.6759 | 67.59% |
| Androgen receptor binding | + | 0.7239 | 72.39% |
| Thyroid receptor binding | + | 0.5453 | 54.53% |
| Glucocorticoid receptor binding | + | 0.6605 | 66.05% |
| Aromatase binding | + | 0.7342 | 73.42% |
| PPAR gamma | + | 0.7804 | 78.04% |
| Honey bee toxicity | - | 0.7668 | 76.68% |
| Biodegradation | - | 0.8250 | 82.50% |
| Crustacea aquatic toxicity | - | 0.5400 | 54.00% |
| Fish aquatic toxicity | + | 0.8126 | 81.26% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.75% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.30% | 96.09% |
| CHEMBL4801 | P29466 | Caspase-1 | 99.09% | 96.85% |
| CHEMBL236 | P41143 | Delta opioid receptor | 98.95% | 99.35% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.26% | 91.11% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 97.89% | 95.93% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 96.73% | 91.03% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 96.06% | 93.00% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 95.55% | 96.11% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.46% | 99.17% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 93.89% | 90.71% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 93.69% | 97.05% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 93.55% | 82.38% |
| CHEMBL4071 | P08311 | Cathepsin G | 93.16% | 94.64% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 92.50% | 90.08% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 92.17% | 90.17% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 92.10% | 95.50% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 92.08% | 99.18% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 92.02% | 98.33% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 91.43% | 92.97% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 90.53% | 96.90% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.74% | 94.45% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.21% | 95.89% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 89.01% | 94.66% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 88.93% | 98.24% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 88.47% | 89.50% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 87.88% | 93.56% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 86.87% | 98.05% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 86.86% | 90.24% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 86.84% | 90.93% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 86.80% | 93.03% |
| CHEMBL3468 | P55210 | Caspase-7 | 85.65% | 95.68% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 85.65% | 96.31% |
| CHEMBL2443 | P49862 | Kallikrein 7 | 85.56% | 94.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.54% | 97.09% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 85.46% | 96.38% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 84.61% | 96.03% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 84.56% | 97.64% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.82% | 89.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.66% | 95.56% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 83.47% | 100.00% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 83.30% | 96.47% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 82.86% | 96.00% |
| CHEMBL1907598 | P05106 | Integrin alpha-V/beta-3 | 82.60% | 95.71% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.36% | 99.15% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.17% | 94.33% |
| CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 81.43% | 97.86% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.35% | 91.19% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 81.30% | 88.42% |
| CHEMBL3784 | Q09472 | Histone acetyltransferase p300 | 80.47% | 93.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 155886894 |
| LOTUS | LTS0011264 |
| wikiData | Q104197006 |