5,7-dihydroxy-2-[2-hydroxy-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]chromen-4-one
Internal ID | 92c07c78-d1b1-44ab-a384-93a542654a3f |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavones |
IUPAC Name | 5,7-dihydroxy-2-[2-hydroxy-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]chromen-4-one |
SMILES (Canonical) | C1=CC(=C(C(=C1)OC2C(C(C(C(O2)CO)O)O)O)C3=CC(=O)C4=C(C=C(C=C4O3)O)O)O |
SMILES (Isomeric) | C1=CC(=C(C(=C1)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)C3=CC(=O)C4=C(C=C(C=C4O3)O)O)O |
InChI | InChI=1S/C21H20O11/c22-7-15-18(27)19(28)20(29)21(32-15)31-12-3-1-2-9(24)17(12)14-6-11(26)16-10(25)4-8(23)5-13(16)30-14/h1-6,15,18-25,27-29H,7H2/t15-,18-,19+,20-,21-/m1/s1 |
InChI Key | YLCGMXKVTQXMCZ-CMWLGVBASA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H20O11 |
Molecular Weight | 448.40 g/mol |
Exact Mass | 448.10056145 g/mol |
Topological Polar Surface Area (TPSA) | 186.00 Ų |
XlogP | 0.50 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.35% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 96.17% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.38% | 89.00% |
CHEMBL3194 | P02766 | Transthyretin | 94.23% | 90.71% |
CHEMBL220 | P22303 | Acetylcholinesterase | 93.41% | 94.45% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.73% | 94.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.47% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.99% | 94.73% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 90.17% | 96.21% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.96% | 86.33% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.43% | 99.15% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.69% | 99.17% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.28% | 99.23% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 81.18% | 91.49% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.94% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.70% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Scutellaria baicalensis |
PubChem | 102445445 |
LOTUS | LTS0240477 |
wikiData | Q105350058 |