Dimethyl 20,21-dihydroxy-5,8,11,14,17,22,29,32,35,38,41,46-dodecamethyl-2,25-dioxaundecacyclo[24.20.0.03,24.04,17.05,14.08,13.018,23.028,45.029,42.032,41.033,38]hexatetraconta-1(26),18,20,22,27,43,45-heptaene-11,35-dicarboxylate
| Internal ID | f8f40389-123a-47fb-bcbd-60e2ec15e4b1 |
| Taxonomy | Benzenoids > Phenanthrenes and derivatives |
| IUPAC Name | dimethyl 20,21-dihydroxy-5,8,11,14,17,22,29,32,35,38,41,46-dodecamethyl-2,25-dioxaundecacyclo[24.20.0.03,24.04,17.05,14.08,13.018,23.028,45.029,42.032,41.033,38]hexatetraconta-1(26),18,20,22,27,43,45-heptaene-11,35-dicarboxylate |
| SMILES (Canonical) | CC1=C2C=CC3C(C2=CC4=C1OC5C(O4)C6=C(C(=C(C=C6C7(C5C8(CCC9(CCC(CC9C8(CC7)C)(C)C(=O)OC)C)C)C)O)O)C)(CCC1(C3(CCC2(C1CC(CC2)(C)C(=O)OC)C)C)C)C |
| SMILES (Isomeric) | CC1=C2C=CC3C(C2=CC4=C1OC5C(O4)C6=C(C(=C(C=C6C7(C5C8(CCC9(CCC(CC9C8(CC7)C)(C)C(=O)OC)C)C)C)O)O)C)(CCC1(C3(CCC2(C1CC(CC2)(C)C(=O)OC)C)C)C)C |
| InChI | InChI=1S/C60H82O8/c1-33-35-15-16-40-55(7,23-27-58(10)41-31-53(5,49(63)65-13)19-17-51(41,3)21-25-57(40,58)9)36(35)30-39-45(33)68-47-46(67-39)43-34(2)44(62)38(61)29-37(43)56(8)24-28-59(11)42-32-54(6,50(64)66-14)20-18-52(42,4)22-26-60(59,12)48(47)56/h15-16,29-30,40-42,46-48,61-62H,17-28,31-32H2,1-14H3 |
| InChI Key | KGXQHWCOFWMMPG-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C60H82O8 |
| Molecular Weight | 931.30 g/mol |
| Exact Mass | 930.60096957 g/mol |
| Topological Polar Surface Area (TPSA) | 112.00 Ų |
| XlogP | 15.40 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.69% | 91.11% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 97.03% | 83.82% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.17% | 94.45% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.89% | 99.23% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 90.23% | 92.94% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.12% | 96.09% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 89.87% | 91.07% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.49% | 95.56% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 89.47% | 95.50% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.77% | 94.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 88.32% | 90.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.47% | 86.33% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.05% | 97.09% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 85.08% | 94.80% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.76% | 96.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.12% | 99.17% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 83.12% | 95.58% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 82.06% | 96.38% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.83% | 94.73% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 81.81% | 91.79% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 81.58% | 82.38% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.04% | 92.62% |
| CHEMBL233 | P35372 | Mu opioid receptor | 80.04% | 97.93% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163057894 |
| LOTUS | LTS0156484 |
| wikiData | Q105141033 |