[(2R,3S,4S,5R,6R)-6-[2-(3,4-dihydroxyphenyl)ethoxy]-5-hydroxy-2-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-4-[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxan-3-yl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate
Internal ID | 46624faa-262d-47a9-bcf6-11a4b01401c4 |
Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Hydroxycinnamic acids and derivatives > Coumaric acids and derivatives |
IUPAC Name | [(2R,3S,4S,5R,6R)-6-[2-(3,4-dihydroxyphenyl)ethoxy]-5-hydroxy-2-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-4-[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxan-3-yl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
SMILES (Canonical) | CC1C(C(C(C(O1)C2C(C(OC(C2OC(=O)C=CC3=CC(=C(C=C3)O)O)COC4C(C(C(C(O4)CO)O)O)O)OCCC5=CC(=C(C=C5)O)O)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@H](O1)[C@@H]2[C@H]([C@@H](O[C@@H]([C@H]2OC(=O)/C=C/C3=CC(=C(C=C3)O)O)CO[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)OCCC5=CC(=C(C=C5)O)O)O)O)O)O |
InChI | InChI=1S/C35H46O19/c1-14-25(42)28(45)30(47)33(51-14)24-27(44)34(49-9-8-16-3-6-18(38)20(40)11-16)53-22(13-50-35-31(48)29(46)26(43)21(12-36)52-35)32(24)54-23(41)7-4-15-2-5-17(37)19(39)10-15/h2-7,10-11,14,21-22,24-40,42-48H,8-9,12-13H2,1H3/b7-4+/t14-,21+,22+,24+,25-,26+,27+,28+,29-,30+,31+,32+,33+,34+,35+/m0/s1 |
InChI Key | HSCLQSPSVTYNJR-MDWIMCBOSA-N |
Popularity | 0 references in papers |
Molecular Formula | C35H46O19 |
Molecular Weight | 770.70 g/mol |
Exact Mass | 770.26332923 g/mol |
Topological Polar Surface Area (TPSA) | 315.00 Ų |
XlogP | -1.90 |
There are no found synonyms. |
![2D Structure of [(2R,3S,4S,5R,6R)-6-[2-(3,4-dihydroxyphenyl)ethoxy]-5-hydroxy-2-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-4-[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxan-3-yl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate 2D Structure of [(2R,3S,4S,5R,6R)-6-[2-(3,4-dihydroxyphenyl)ethoxy]-5-hydroxy-2-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-4-[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxan-3-yl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/9f10bcd0-8620-11ee-86a7-21953b608ee1.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.71% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.00% | 91.49% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.40% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.66% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.69% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 94.57% | 94.73% |
CHEMBL2581 | P07339 | Cathepsin D | 94.33% | 98.95% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 94.01% | 96.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.82% | 89.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 90.23% | 96.95% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 89.96% | 86.92% |
CHEMBL3194 | P02766 | Transthyretin | 89.78% | 90.71% |
CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 87.02% | 96.37% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 87.02% | 94.80% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.09% | 94.45% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.29% | 90.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.32% | 97.09% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 80.09% | 80.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Echinacea purpurea |
PubChem | 163193110 |
LOTUS | LTS0068610 |
wikiData | Q105032975 |