[(3S,4aR,6aR,8S,10R,10aR,10bS)-3-ethenyl-8-hydroxy-3,4a,7,7,10a-pentamethyl-5-oxo-1,2,6,6a,8,9,10,10b-octahydrobenzo[f]chromen-10-yl] (Z)-2-methylbut-2-enoate
Internal ID | 112c199a-0f6f-4b27-bd5e-8bf82990d4d8 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | [(3S,4aR,6aR,8S,10R,10aR,10bS)-3-ethenyl-8-hydroxy-3,4a,7,7,10a-pentamethyl-5-oxo-1,2,6,6a,8,9,10,10b-octahydrobenzo[f]chromen-10-yl] (Z)-2-methylbut-2-enoate |
SMILES (Canonical) | CC=C(C)C(=O)OC1CC(C(C2C1(C3CCC(OC3(C(=O)C2)C)(C)C=C)C)(C)C)O |
SMILES (Isomeric) | C/C=C(/C)\C(=O)O[C@@H]1C[C@@H](C([C@@H]2[C@@]1([C@@H]3CC[C@@](O[C@]3(C(=O)C2)C)(C)C=C)C)(C)C)O |
InChI | InChI=1S/C25H38O5/c1-9-15(3)21(28)29-20-14-18(26)22(4,5)17-13-19(27)25(8)16(24(17,20)7)11-12-23(6,10-2)30-25/h9-10,16-18,20,26H,2,11-14H2,1,3-8H3/b15-9-/t16-,17+,18-,20+,23+,24-,25+/m0/s1 |
InChI Key | PJBKSBHTBDKPOF-ABRSADFHSA-N |
Popularity | 0 references in papers |
Molecular Formula | C25H38O5 |
Molecular Weight | 418.60 g/mol |
Exact Mass | 418.27192431 g/mol |
Topological Polar Surface Area (TPSA) | 72.80 Ų |
XlogP | 4.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.81% | 91.11% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 93.37% | 94.75% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 91.91% | 92.94% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 91.48% | 91.19% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.98% | 96.09% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.35% | 99.23% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.40% | 97.09% |
CHEMBL1907601 | P11802 | Cyclin-dependent kinase 4/cyclin D1 | 86.99% | 98.99% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.65% | 89.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.22% | 92.62% |
CHEMBL2581 | P07339 | Cathepsin D | 84.95% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.54% | 86.33% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.13% | 100.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.94% | 95.56% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 81.93% | 93.04% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 81.60% | 82.69% |
CHEMBL325 | Q13547 | Histone deacetylase 1 | 81.32% | 95.92% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.03% | 95.89% |
CHEMBL3524 | P56524 | Histone deacetylase 4 | 80.11% | 92.97% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Helichrysum ambiguum |
PubChem | 163016255 |
LOTUS | LTS0227998 |
wikiData | Q105209861 |