[(2S,3R,4S,5S,6R)-2-[(2R,3R,4S,6S)-6-[(2R,3R,4S,6S)-6-[(2R,3R,4S,6S)-6-[(2'R,3'R,4S,4'R,5aR,6R,8S,9aR)-8-[(1S)-1-[(3S,8R,9S,10R,13S,14S,17R)-3,17-dihydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]ethoxy]-4'-methoxy-2',6-dimethylspiro[6,8,9,9a-tetrahydro-5aH-pyrano[3,4-f][1,3,5]trioxepine-4,6'-oxane]-3'-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-5-hydroxy-4-methoxy-6-methyloxan-3-yl] acetate
Internal ID | 15d23280-bcbc-49fb-bd71-368c83aadd7c |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
IUPAC Name | [(2S,3R,4S,5S,6R)-2-[(2R,3R,4S,6S)-6-[(2R,3R,4S,6S)-6-[(2R,3R,4S,6S)-6-[(2'R,3'R,4S,4'R,5aR,6R,8S,9aR)-8-[(1S)-1-[(3S,8R,9S,10R,13S,14S,17R)-3,17-dihydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]ethoxy]-4'-methoxy-2',6-dimethylspiro[6,8,9,9a-tetrahydro-5aH-pyrano[3,4-f][1,3,5]trioxepine-4,6'-oxane]-3'-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-5-hydroxy-4-methoxy-6-methyloxan-3-yl] acetate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(OC(CC2OC)OC3C(OC(CC3OC)OC4C(OC(CC4OC)OC5C(OC6(CC5OC)OCOC7CC(OC(C7O6)C)OC(C)C8(CCC9C8(CCC1C9CC=C2C1(CCC(C2)O)C)C)O)C)C)C)C)OC(=O)C)OC)O |
SMILES (Isomeric) | C[C@@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)O[C@@H]2[C@H](O[C@H](C[C@@H]2OC)O[C@@H]3[C@H](O[C@H](C[C@@H]3OC)O[C@@H]4[C@H](O[C@H](C[C@@H]4OC)O[C@@H]5[C@H](O[C@]6(C[C@H]5OC)OCO[C@@H]7C[C@@H](O[C@@H]([C@H]7O6)C)O[C@@H](C)[C@]8(CC[C@@H]9[C@@]8(CC[C@H]1[C@H]9CC=C2[C@@]1(CC[C@@H](C2)O)C)C)O)C)C)C)C)OC(=O)C)OC)O |
InChI | InChI=1S/C65H106O24/c1-31-53(68)59(74-15)60(83-38(8)66)61(81-31)87-56-34(4)79-51(27-46(56)72-13)85-54-32(2)77-50(25-44(54)70-11)84-55-33(3)78-52(26-45(55)71-12)86-57-36(6)88-65(29-48(57)73-14)76-30-75-47-28-49(80-35(5)58(47)89-65)82-37(7)64(69)23-20-43-41-17-16-39-24-40(67)18-21-62(39,9)42(41)19-22-63(43,64)10/h16,31-37,40-61,67-69H,17-30H2,1-15H3/t31-,32-,33-,34-,35-,36-,37+,40+,41-,42+,43+,44+,45+,46+,47-,48-,49+,50+,51+,52+,53+,54-,55-,56-,57-,58-,59+,60-,61+,62+,63+,64+,65+/m1/s1 |
InChI Key | ZZNYTIQKQNIAFL-MAJNGXEJSA-N |
Popularity | 0 references in papers |
Molecular Formula | C65H106O24 |
Molecular Weight | 1271.50 g/mol |
Exact Mass | 1270.70740424 g/mol |
Topological Polar Surface Area (TPSA) | 262.00 Ų |
XlogP | 4.70 |
There are no found synonyms. |
![2D Structure of [(2S,3R,4S,5S,6R)-2-[(2R,3R,4S,6S)-6-[(2R,3R,4S,6S)-6-[(2R,3R,4S,6S)-6-[(2'R,3'R,4S,4'R,5aR,6R,8S,9aR)-8-[(1S)-1-[(3S,8R,9S,10R,13S,14S,17R)-3,17-dihydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]ethoxy]-4'-methoxy-2',6-dimethylspiro[6,8,9,9a-tetrahydro-5aH-pyrano[3,4-f][1,3,5]trioxepine-4,6'-oxane]-3'-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-5-hydroxy-4-methoxy-6-methyloxan-3-yl] acetate 2D Structure of [(2S,3R,4S,5S,6R)-2-[(2R,3R,4S,6S)-6-[(2R,3R,4S,6S)-6-[(2R,3R,4S,6S)-6-[(2'R,3'R,4S,4'R,5aR,6R,8S,9aR)-8-[(1S)-1-[(3S,8R,9S,10R,13S,14S,17R)-3,17-dihydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]ethoxy]-4'-methoxy-2',6-dimethylspiro[6,8,9,9a-tetrahydro-5aH-pyrano[3,4-f][1,3,5]trioxepine-4,6'-oxane]-3'-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-5-hydroxy-4-methoxy-6-methyloxan-3-yl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/9ef43240-8626-11ee-9b8e-1f941dea9193.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.37% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.18% | 96.09% |
CHEMBL204 | P00734 | Thrombin | 97.45% | 96.01% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 97.37% | 95.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 95.85% | 95.89% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.37% | 94.45% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 94.09% | 100.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.98% | 89.00% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 92.36% | 96.77% |
CHEMBL2581 | P07339 | Cathepsin D | 92.06% | 98.95% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.91% | 97.25% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 91.54% | 95.93% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 90.91% | 95.71% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 90.44% | 91.19% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 90.36% | 97.14% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 88.90% | 92.62% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.82% | 86.33% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.84% | 85.14% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.71% | 94.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.60% | 97.09% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 86.97% | 94.08% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.30% | 95.56% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 86.00% | 92.88% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 85.97% | 97.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.72% | 95.89% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.13% | 93.56% |
CHEMBL5028 | O14672 | ADAM10 | 82.98% | 97.50% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 82.72% | 97.36% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.69% | 92.50% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 82.51% | 100.00% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 81.85% | 91.03% |
CHEMBL2959 | Q08881 | Tyrosine-protein kinase ITK/TSK | 81.41% | 95.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.33% | 96.00% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 81.26% | 97.28% |
CHEMBL1871 | P10275 | Androgen Receptor | 80.77% | 96.43% |
CHEMBL4073 | P09237 | Matrix metalloproteinase 7 | 80.46% | 97.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Periploca sepium |
PubChem | 162865073 |
LOTUS | LTS0142742 |
wikiData | Q105386945 |