1-[2,4-Dihydroxy-3-(3-hydroxy-3-methylbutyl)phenyl]-17-[2-(2,4-dihydroxyphenyl)ethenyl]-11-methyl-2,20-dioxapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-3(8),4,6,11,14,16,18-heptaene-5,15-diol
Internal ID | b8832539-62a4-4af7-a176-4dea24b1c817 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavans > 3-prenylated flavans |
IUPAC Name | 1-[2,4-dihydroxy-3-(3-hydroxy-3-methylbutyl)phenyl]-17-[2-(2,4-dihydroxyphenyl)ethenyl]-11-methyl-2,20-dioxapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-3(8),4,6,11,14,16,18-heptaene-5,15-diol |
SMILES (Canonical) | CC1=CC2C3C(C1)C4=C(C=C(C=C4)O)OC3(OC5=CC(=CC(=C25)O)C=CC6=C(C=C(C=C6)O)O)C7=C(C(=C(C=C7)O)CCC(C)(C)O)O |
SMILES (Isomeric) | CC1=CC2C3C(C1)C4=C(C=C(C=C4)O)OC3(OC5=CC(=CC(=C25)O)C=CC6=C(C=C(C=C6)O)O)C7=C(C(=C(C=C7)O)CCC(C)(C)O)O |
InChI | InChI=1S/C39H38O9/c1-20-14-27-25-9-8-24(41)19-33(25)47-39(29-10-11-30(42)26(37(29)45)12-13-38(2,3)46)36(27)28(15-20)35-32(44)16-21(17-34(35)48-39)4-5-22-6-7-23(40)18-31(22)43/h4-11,15-19,27-28,36,40-46H,12-14H2,1-3H3 |
InChI Key | QAJFPEYQEDURAN-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C39H38O9 |
Molecular Weight | 650.70 g/mol |
Exact Mass | 650.25158279 g/mol |
Topological Polar Surface Area (TPSA) | 160.00 Ų |
XlogP | 6.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.83% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 96.85% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.34% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.09% | 86.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.23% | 97.09% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 93.82% | 89.63% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.76% | 95.56% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 93.41% | 85.31% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.56% | 96.09% |
CHEMBL236 | P41143 | Delta opioid receptor | 92.53% | 99.35% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.21% | 94.73% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 90.33% | 89.62% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 89.97% | 95.17% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.51% | 95.89% |
CHEMBL233 | P35372 | Mu opioid receptor | 89.47% | 97.93% |
CHEMBL3194 | P02766 | Transthyretin | 86.18% | 90.71% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 84.74% | 89.05% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 84.73% | 93.56% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.30% | 100.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.36% | 99.15% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 83.30% | 93.99% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.16% | 90.00% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 83.05% | 93.18% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 82.59% | 97.25% |
CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 82.36% | 96.39% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 82.29% | 93.40% |
CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 81.97% | 92.68% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.91% | 94.45% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 81.59% | 90.24% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 81.52% | 95.58% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.39% | 90.71% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.33% | 99.23% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.24% | 92.94% |
CHEMBL4829 | O00763 | Acetyl-CoA carboxylase 2 | 81.05% | 98.00% |
CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 80.79% | 95.34% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.44% | 85.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Sorocea guilleminiana |
PubChem | 73079438 |
LOTUS | LTS0164558 |
wikiData | Q105217460 |