[(3S,4S,5S,8S,10S,13R,14S,17R)-4,10,13,14-tetramethyl-17-[(Z,2R)-5-propan-2-ylhept-5-en-2-yl]-1,2,3,4,5,6,7,8,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate
Internal ID | a2ca7d00-39af-4c67-a77d-7c46f6fc3f83 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Stigmastanes and derivatives |
IUPAC Name | [(3S,4S,5S,8S,10S,13R,14S,17R)-4,10,13,14-tetramethyl-17-[(Z,2R)-5-propan-2-ylhept-5-en-2-yl]-1,2,3,4,5,6,7,8,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate |
SMILES (Canonical) | CC=C(CCC(C)C1CCC2(C1(CC=C3C2CCC4C3(CCC(C4C)OC(=O)C)C)C)C)C(C)C |
SMILES (Isomeric) | C/C=C(/CC[C@@H](C)[C@H]1CC[C@@]2([C@@]1(CC=C3[C@H]2CC[C@@H]4[C@@]3(CC[C@@H]([C@H]4C)OC(=O)C)C)C)C)\C(C)C |
InChI | InChI=1S/C33H54O2/c1-10-25(21(2)3)12-11-22(4)26-15-19-33(9)29-14-13-27-23(5)30(35-24(6)34)17-18-31(27,7)28(29)16-20-32(26,33)8/h10,16,21-23,26-27,29-30H,11-15,17-20H2,1-9H3/b25-10-/t22-,23+,26-,27+,29-,30+,31+,32-,33+/m1/s1 |
InChI Key | IEAZXYJYELWPEQ-XIZANSJMSA-N |
Popularity | 0 references in papers |
Molecular Formula | C33H54O2 |
Molecular Weight | 482.80 g/mol |
Exact Mass | 482.412380961 g/mol |
Topological Polar Surface Area (TPSA) | 26.30 Ų |
XlogP | 10.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.00% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.02% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 96.12% | 98.95% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.28% | 97.25% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.35% | 94.45% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 91.28% | 95.89% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 90.94% | 89.05% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 90.54% | 90.17% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.02% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.15% | 95.56% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.36% | 100.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.71% | 91.19% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.36% | 95.89% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 83.47% | 97.79% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.25% | 100.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.23% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.04% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Phaseolus vulgaris |
PubChem | 162997278 |
LOTUS | LTS0105948 |
wikiData | Q105111665 |