5,7-dihydroxy-2-(3-hydroxyphenyl)-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one
Internal ID | 26b1ed7b-1d68-4c5a-b0b5-d6015a176afb |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-3-O-glycosides |
IUPAC Name | 5,7-dihydroxy-2-(3-hydroxyphenyl)-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | C1=CC(=CC(=C1)O)C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)OC4C(C(C(C(O4)CO)O)O)O |
SMILES (Isomeric) | C1=CC(=CC(=C1)O)C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O |
InChI | InChI=1S/C21H20O11/c22-7-13-15(26)17(28)18(29)21(31-13)32-20-16(27)14-11(25)5-10(24)6-12(14)30-19(20)8-2-1-3-9(23)4-8/h1-6,13,15,17-18,21-26,28-29H,7H2/t13-,15-,17+,18-,21+/m1/s1 |
InChI Key | JWFZDJQNRNIKEB-QSOFNFLRSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H20O11 |
Molecular Weight | 448.40 g/mol |
Exact Mass | 448.10056145 g/mol |
Topological Polar Surface Area (TPSA) | 186.00 Ų |
XlogP | 0.70 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.22% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 97.76% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.04% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.71% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.77% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.31% | 94.73% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.25% | 94.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.40% | 99.17% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.31% | 99.15% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.48% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.00% | 97.09% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.66% | 99.23% |
CHEMBL3194 | P02766 | Transthyretin | 81.71% | 90.71% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 81.67% | 91.49% |
CHEMBL5678 | P34947 | G protein-coupled receptor kinase 5 | 80.42% | 88.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Costus spicatus |
PubChem | 162936981 |
LOTUS | LTS0063036 |
wikiData | Q105136134 |