3,4,5,14,15,16-Hexamethoxy-9,10-dimethyltricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaene-8,9-diol
| Internal ID | 7bf8b9e9-b0e1-41e8-9bb6-9c81d38bf32b |
| Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
| IUPAC Name | 3,4,5,14,15,16-hexamethoxy-9,10-dimethyltricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaene-8,9-diol |
| SMILES (Canonical) | CC1CC2=CC(=C(C(=C2C3=C(C(=C(C=C3C(C1(C)O)O)OC)OC)OC)OC)OC)OC |
| SMILES (Isomeric) | CC1CC2=CC(=C(C(=C2C3=C(C(=C(C=C3C(C1(C)O)O)OC)OC)OC)OC)OC)OC |
| InChI | InChI=1S/C24H32O8/c1-12-9-13-10-15(27-3)19(29-5)21(31-7)17(13)18-14(23(25)24(12,2)26)11-16(28-4)20(30-6)22(18)32-8/h10-12,23,25-26H,9H2,1-8H3 |
| InChI Key | RENKUVKNQJCSQP-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C24H32O8 |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.20971797 g/mol |
| Topological Polar Surface Area (TPSA) | 95.80 Ų |
| XlogP | 2.90 |
| There are no found synonyms. |
![2D Structure of 3,4,5,14,15,16-Hexamethoxy-9,10-dimethyltricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaene-8,9-diol](https://plantaedb.com/storage/docs/compounds/2023/11/9e501700-856f-11ee-ac06-0502cb7c0e9e.jpg "2D Structure of 3,4,5,14,15,16-Hexamethoxy-9,10-dimethyltricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaene-8,9-diol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.80% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.12% | 91.11% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.70% | 86.33% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 91.53% | 95.62% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 91.35% | 92.94% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 89.99% | 95.89% |
| CHEMBL261 | P00915 | Carbonic anhydrase I | 87.43% | 96.76% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.63% | 95.56% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.44% | 95.89% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.12% | 94.45% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 84.67% | 92.68% |
| CHEMBL2535 | P11166 | Glucose transporter | 84.64% | 98.75% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 83.14% | 91.03% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.40% | 90.00% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 81.94% | 91.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.58% | 99.17% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.24% | 100.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.77% | 97.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 80.51% | 98.95% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.46% | 97.14% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 80.39% | 91.79% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.15% | 85.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Schisandra rubriflora |
| PubChem | 73830472 |
| LOTUS | LTS0079675 |
| wikiData | Q105234979 |