2,3,4'-trihydroxy-4,4,7,8a-tetramethyl-6'-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]spiro[2,3,4a,5,6,7-hexahydro-1H-naphthalene-8,2'-3H-1-benzofuran]-7'-carbaldehyde
| Internal ID | e811c4d7-6e58-4121-9f38-33a622310a00 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > O-glycosyl compounds |
| IUPAC Name | 2,3,4'-trihydroxy-4,4,7,8a-tetramethyl-6'-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]spiro[2,3,4a,5,6,7-hexahydro-1H-naphthalene-8,2'-3H-1-benzofuran]-7'-carbaldehyde |
| SMILES (Canonical) | CC1CCC2C(C(C(CC2(C13CC4=C(C=C(C(=C4O3)C=O)COC5C(C(C(C(O5)CO)O)O)O)O)C)O)O)(C)C |
| SMILES (Isomeric) | CC1CCC2C(C(C(CC2(C13CC4=C(C=C(C(=C4O3)C=O)COC5C(C(C(C(O5)CO)O)O)O)O)C)O)O)(C)C |
| InChI | InChI=1S/C29H42O11/c1-13-5-6-20-27(2,3)25(37)18(33)9-28(20,4)29(13)8-15-17(32)7-14(16(10-30)24(15)40-29)12-38-26-23(36)22(35)21(34)19(11-31)39-26/h7,10,13,18-23,25-26,31-37H,5-6,8-9,11-12H2,1-4H3 |
| InChI Key | RBPQAJXLZIGYHF-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C29H42O11 |
| Molecular Weight | 566.60 g/mol |
| Exact Mass | 566.27271215 g/mol |
| Topological Polar Surface Area (TPSA) | 186.00 Ų |
| XlogP | 0.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.36% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.59% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.12% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.33% | 98.95% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.03% | 97.09% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.65% | 89.00% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.14% | 100.00% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 88.62% | 92.94% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.06% | 95.89% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 86.72% | 93.40% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.11% | 85.14% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 85.67% | 91.49% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 85.14% | 95.83% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 84.64% | 95.50% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.49% | 94.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.50% | 86.33% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.71% | 99.17% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 82.31% | 91.24% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.09% | 94.73% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 81.80% | 97.33% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 80.57% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162953666 |
| LOTUS | LTS0181019 |
| wikiData | Q104196444 |