[(2S,3R,4S,5R)-2-[[(1S,3R,6S,8R,9S,11S,12S,14S,15R,16R)-15-[(2R,5R)-5,6-dihydroxy-6-methylheptan-2-yl]-9,14-dihydroxy-7,7,12,16-tetramethyl-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]-5-hydroxy-3-[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-4-yl] acetate
Internal ID | 4795795a-f56d-44c9-80a3-0421b29eae9f |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins > Cucurbitacin glycosides |
IUPAC Name | [(2S,3R,4S,5R)-2-[[(1S,3R,6S,8R,9S,11S,12S,14S,15R,16R)-15-[(2R,5R)-5,6-dihydroxy-6-methylheptan-2-yl]-9,14-dihydroxy-7,7,12,16-tetramethyl-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]-5-hydroxy-3-[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-4-yl] acetate |
SMILES (Canonical) | CC(CCC(C(C)(C)O)O)C1C(CC2(C1(CCC34C2CC(C5C3(C4)CCC(C5(C)C)OC6C(C(C(CO6)O)OC(=O)C)OC7C(C(C(CO7)O)O)O)O)C)C)O |
SMILES (Isomeric) | C[C@H](CC[C@H](C(C)(C)O)O)[C@H]1[C@H](C[C@@]2([C@@]1(CC[C@]34[C@H]2C[C@@H]([C@@H]5[C@]3(C4)CC[C@@H](C5(C)C)O[C@H]6[C@@H]([C@H]([C@@H](CO6)O)OC(=O)C)O[C@H]7[C@@H]([C@H]([C@H](CO7)O)O)O)O)C)C)O |
InChI | InChI=1S/C42H70O14/c1-20(9-10-27(48)38(5,6)51)29-23(45)16-40(8)26-15-22(44)34-37(3,4)28(11-12-42(34)19-41(26,42)14-13-39(29,40)7)55-36-33(32(54-21(2)43)25(47)18-53-36)56-35-31(50)30(49)24(46)17-52-35/h20,22-36,44-51H,9-19H2,1-8H3/t20-,22+,23+,24+,25-,26+,27-,28+,29+,30+,31-,32+,33-,34+,35+,36+,39-,40+,41+,42-/m1/s1 |
InChI Key | AVQLBIFRCZFBNU-RGMIIOFBSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C42H70O14 |
Molecular Weight | 799.00 g/mol |
Exact Mass | 798.47655690 g/mol |
Topological Polar Surface Area (TPSA) | 225.00 Ų |
XlogP | 2.10 |
Atomic LogP (AlogP) | 1.77 |
H-Bond Acceptor | 14 |
H-Bond Donor | 8 |
Rotatable Bonds | 10 |
There are no found synonyms. |
![2D Structure of [(2S,3R,4S,5R)-2-[[(1S,3R,6S,8R,9S,11S,12S,14S,15R,16R)-15-[(2R,5R)-5,6-dihydroxy-6-methylheptan-2-yl]-9,14-dihydroxy-7,7,12,16-tetramethyl-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]-5-hydroxy-3-[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-4-yl] acetate 2D Structure of [(2S,3R,4S,5R)-2-[[(1S,3R,6S,8R,9S,11S,12S,14S,15R,16R)-15-[(2R,5R)-5,6-dihydroxy-6-methylheptan-2-yl]-9,14-dihydroxy-7,7,12,16-tetramethyl-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]-5-hydroxy-3-[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-4-yl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/9e415030-8050-11ee-b7c5-4fd19988ad87.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.6552 | 65.52% |
Caco-2 | - | 0.8870 | 88.70% |
Blood Brain Barrier | - | 0.6500 | 65.00% |
Human oral bioavailability | - | 0.7143 | 71.43% |
Subcellular localzation | Mitochondria | 0.7255 | 72.55% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.8130 | 81.30% |
OATP1B3 inhibitior | + | 0.9078 | 90.78% |
MATE1 inhibitior | - | 1.0000 | 100.00% |
OCT2 inhibitior | - | 0.7500 | 75.00% |
BSEP inhibitior | + | 0.6941 | 69.41% |
P-glycoprotein inhibitior | + | 0.7548 | 75.48% |
P-glycoprotein substrate | + | 0.6063 | 60.63% |
CYP3A4 substrate | + | 0.7379 | 73.79% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.8811 | 88.11% |
CYP3A4 inhibition | - | 0.9440 | 94.40% |
CYP2C9 inhibition | - | 0.8021 | 80.21% |
CYP2C19 inhibition | - | 0.8374 | 83.74% |
CYP2D6 inhibition | - | 0.9537 | 95.37% |
CYP1A2 inhibition | - | 0.8942 | 89.42% |
CYP2C8 inhibition | + | 0.6305 | 63.05% |
CYP inhibitory promiscuity | - | 0.9716 | 97.16% |
UGT catelyzed | + | 0.9000 | 90.00% |
Carcinogenicity (binary) | - | 0.9900 | 99.00% |
Carcinogenicity (trinary) | Non-required | 0.6866 | 68.66% |
Eye corrosion | - | 0.9901 | 99.01% |
Eye irritation | - | 0.9107 | 91.07% |
Skin irritation | - | 0.6890 | 68.90% |
Skin corrosion | - | 0.9451 | 94.51% |
Ames mutagenesis | - | 0.5878 | 58.78% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.7082 | 70.82% |
Micronuclear | - | 0.7900 | 79.00% |
Hepatotoxicity | - | 0.7155 | 71.55% |
skin sensitisation | - | 0.9036 | 90.36% |
Respiratory toxicity | + | 0.5444 | 54.44% |
Reproductive toxicity | + | 0.7667 | 76.67% |
Mitochondrial toxicity | + | 0.6000 | 60.00% |
Nephrotoxicity | - | 0.7272 | 72.72% |
Acute Oral Toxicity (c) | I | 0.5532 | 55.32% |
Estrogen receptor binding | + | 0.7639 | 76.39% |
Androgen receptor binding | + | 0.7387 | 73.87% |
Thyroid receptor binding | - | 0.6063 | 60.63% |
Glucocorticoid receptor binding | + | 0.6495 | 64.95% |
Aromatase binding | + | 0.6668 | 66.68% |
PPAR gamma | + | 0.7464 | 74.64% |
Honey bee toxicity | - | 0.6008 | 60.08% |
Biodegradation | - | 0.7000 | 70.00% |
Crustacea aquatic toxicity | - | 0.5300 | 53.00% |
Fish aquatic toxicity | + | 0.9147 | 91.47% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.71% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.90% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.93% | 91.11% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 94.76% | 95.58% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 94.59% | 96.77% |
CHEMBL2581 | P07339 | Cathepsin D | 94.53% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.66% | 94.45% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 91.61% | 92.88% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 91.60% | 91.24% |
CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 91.11% | 95.69% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 90.32% | 95.71% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 90.20% | 91.19% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.86% | 89.00% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 89.63% | 82.69% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 89.62% | 97.14% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 89.56% | 96.47% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.13% | 97.09% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 89.12% | 95.17% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.38% | 85.14% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 88.07% | 91.07% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 87.91% | 100.00% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 87.73% | 82.50% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 87.52% | 95.71% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 87.52% | 100.00% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 87.50% | 97.21% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 87.39% | 98.75% |
CHEMBL204 | P00734 | Thrombin | 87.11% | 96.01% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 85.95% | 91.03% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 85.86% | 89.50% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 85.42% | 85.31% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 84.88% | 100.00% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 84.60% | 94.33% |
CHEMBL2007625 | O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | 83.78% | 99.00% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 83.53% | 96.61% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.46% | 95.89% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 83.45% | 94.62% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 82.77% | 89.34% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.56% | 95.89% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.55% | 92.62% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.05% | 100.00% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 81.89% | 90.24% |
CHEMBL4482 | O96013 | Serine/threonine-protein kinase PAK 4 | 81.56% | 95.42% |
CHEMBL4660 | P28907 | Lymphocyte differentiation antigen CD38 | 81.26% | 95.27% |
CHEMBL1907598 | P05106 | Integrin alpha-V/beta-3 | 81.24% | 95.71% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.05% | 96.95% |
CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 80.97% | 92.78% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 80.93% | 94.78% |
CHEMBL5028 | O14672 | ADAM10 | 80.66% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Astragalus taschkendicus |
PubChem | 162911055 |
LOTUS | LTS0241357 |
wikiData | Q104919730 |