[(E,6R)-6-[(8S,9R,10S,13R,14S,16R,17R)-2,16-dihydroxy-4,4,9,13,14-pentamethyl-3,11-dioxo-8,10,12,15,16,17-hexahydro-7H-cyclopenta[a]phenanthren-17-yl]-6-hydroxy-2-methyl-5-oxohept-3-en-2-yl] acetate
Internal ID | 3fc0d583-4fd5-4fba-bcb8-0103f5f7b490 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Cucurbitacins |
IUPAC Name | [(E,6R)-6-[(8S,9R,10S,13R,14S,16R,17R)-2,16-dihydroxy-4,4,9,13,14-pentamethyl-3,11-dioxo-8,10,12,15,16,17-hexahydro-7H-cyclopenta[a]phenanthren-17-yl]-6-hydroxy-2-methyl-5-oxohept-3-en-2-yl] acetate |
SMILES (Canonical) | CC(=O)OC(C)(C)C=CC(=O)C(C)(C1C(CC2(C1(CC(=O)C3(C2CC=C4C3C=C(C(=O)C4(C)C)O)C)C)C)O)O |
SMILES (Isomeric) | CC(=O)OC(C)(C)/C=C/C(=O)[C@@](C)([C@H]1[C@@H](C[C@@]2([C@@]1(CC(=O)[C@@]3([C@H]2CC=C4[C@@H]3C=C(C(=O)C4(C)C)O)C)C)C)O)O |
InChI | InChI=1S/C32H44O8/c1-17(33)40-27(2,3)13-12-23(36)32(9,39)25-21(35)15-29(6)22-11-10-18-19(14-20(34)26(38)28(18,4)5)31(22,8)24(37)16-30(25,29)7/h10,12-14,19,21-22,25,34-35,39H,11,15-16H2,1-9H3/b13-12+/t19-,21+,22-,25-,29-,30+,31-,32-/m0/s1 |
InChI Key | NDYMQXYDSVBNLL-SPQFGWAASA-N |
Popularity | 0 references in papers |
Molecular Formula | C32H44O8 |
Molecular Weight | 556.70 g/mol |
Exact Mass | 556.30361836 g/mol |
Topological Polar Surface Area (TPSA) | 138.00 Ų |
XlogP | 3.20 |
There are no found synonyms. |
![2D Structure of [(E,6R)-6-[(8S,9R,10S,13R,14S,16R,17R)-2,16-dihydroxy-4,4,9,13,14-pentamethyl-3,11-dioxo-8,10,12,15,16,17-hexahydro-7H-cyclopenta[a]phenanthren-17-yl]-6-hydroxy-2-methyl-5-oxohept-3-en-2-yl] acetate 2D Structure of [(E,6R)-6-[(8S,9R,10S,13R,14S,16R,17R)-2,16-dihydroxy-4,4,9,13,14-pentamethyl-3,11-dioxo-8,10,12,15,16,17-hexahydro-7H-cyclopenta[a]phenanthren-17-yl]-6-hydroxy-2-methyl-5-oxohept-3-en-2-yl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/9e0edac0-8667-11ee-87e7-5d1ea16e87df.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.44% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.39% | 94.45% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.86% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 94.79% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.55% | 96.09% |
CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 92.81% | 87.67% |
CHEMBL1902 | P62942 | FK506-binding protein 1A | 91.93% | 97.05% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 89.39% | 95.62% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.35% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.31% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.28% | 97.09% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 86.68% | 96.95% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.78% | 99.23% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.77% | 91.19% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.21% | 100.00% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 84.86% | 91.07% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 84.75% | 97.25% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 81.88% | 91.03% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.71% | 95.89% |
CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 81.41% | 96.39% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Citrullus lanatus |
Nernstia mexicana |
PubChem | 12304229 |
LOTUS | LTS0182300 |
wikiData | Q105177787 |