[20-Hydroxy-9,9,14,18-tetramethyl-17-[1-(5-methyl-6-oxo-2,3-dihydropyran-2-yl)ethyl]-7-oxo-3,8-dioxapentacyclo[11.7.0.02,4.04,10.014,18]icosa-1(13),5-dien-15-yl] acetate
| Internal ID | 01ddb883-b8d1-4eaa-8a06-099a453946f0 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Tricarboxylic acids and derivatives |
| IUPAC Name | [20-hydroxy-9,9,14,18-tetramethyl-17-[1-(5-methyl-6-oxo-2,3-dihydropyran-2-yl)ethyl]-7-oxo-3,8-dioxapentacyclo[11.7.0.02,4.04,10.014,18]icosa-1(13),5-dien-15-yl] acetate |
| SMILES (Canonical) | CC1=CCC(OC1=O)C(C)C2CC(C3(C2(CC(C4=C3CCC5C(OC(=O)C=CC56C4O6)(C)C)O)C)C)OC(=O)C |
| SMILES (Isomeric) | CC1=CCC(OC1=O)C(C)C2CC(C3(C2(CC(C4=C3CCC5C(OC(=O)C=CC56C4O6)(C)C)O)C)C)OC(=O)C |
| InChI | InChI=1S/C32H42O8/c1-16-8-10-22(38-28(16)36)17(2)20-14-24(37-18(3)33)31(7)19-9-11-23-29(4,5)39-25(35)12-13-32(23)27(40-32)26(19)21(34)15-30(20,31)6/h8,12-13,17,20-24,27,34H,9-11,14-15H2,1-7H3 |
| InChI Key | KRDFFNXFJUTIID-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C32H42O8 |
| Molecular Weight | 554.70 g/mol |
| Exact Mass | 554.28796829 g/mol |
| Topological Polar Surface Area (TPSA) | 112.00 Ų |
| XlogP | 3.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.28% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.95% | 94.45% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.13% | 95.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.78% | 89.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.75% | 99.23% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 90.64% | 91.07% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 90.03% | 93.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.55% | 96.09% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 88.92% | 97.14% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.29% | 86.33% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.14% | 97.09% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.70% | 91.19% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.43% | 98.95% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.24% | 94.00% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.11% | 100.00% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 85.04% | 93.03% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.91% | 95.89% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.63% | 95.89% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 83.22% | 94.08% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 83.01% | 96.47% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 80.83% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162868973 |
| LOTUS | LTS0187538 |
| wikiData | Q104170543 |