(2S)-N-[5-[3-[4-[3-(4-aminobutylamino)propanoylamino]butylamino]propanoylamino]pentyl]-2-[[(2S)-5-amino-2-[[2-(4-hydroxy-1H-indol-3-yl)acetyl]amino]pentanoyl]amino]butanediamide
| Internal ID | 00032821-afd2-46e8-99f5-88f34cf86b50 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides |
| IUPAC Name | (2S)-N-[5-[3-[4-[3-(4-aminobutylamino)propanoylamino]butylamino]propanoylamino]pentyl]-2-[[(2S)-5-amino-2-[[2-(4-hydroxy-1H-indol-3-yl)acetyl]amino]pentanoyl]amino]butanediamide |
| SMILES (Canonical) | C1=CC2=C(C(=C1)O)C(=CN2)CC(=O)NC(CCCN)C(=O)NC(CC(=O)N)C(=O)NCCCCCNC(=O)CCNCCCCNC(=O)CCNCCCCN |
| SMILES (Isomeric) | C1=CC2=C(C(=C1)O)C(=CN2)CC(=O)N[C@@H](CCCN)C(=O)N[C@@H](CC(=O)N)C(=O)NCCCCCNC(=O)CCNCCCCNC(=O)CCNCCCCN |
| InChI | InChI=1S/C38H65N11O7/c39-15-2-5-17-42-22-13-34(53)45-20-7-6-18-43-23-14-33(52)44-19-3-1-4-21-46-37(55)30(25-32(41)51)49-38(56)29(11-9-16-40)48-35(54)24-27-26-47-28-10-8-12-31(50)36(27)28/h8,10,12,26,29-30,42-43,47,50H,1-7,9,11,13-25,39-40H2,(H2,41,51)(H,44,52)(H,45,53)(H,46,55)(H,48,54)(H,49,56)/t29-,30-/m0/s1 |
| InChI Key | XQZUZESKBCMJOG-KYJUHHDHSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C38H65N11O7 |
| Molecular Weight | 788.00 g/mol |
| Exact Mass | 787.50684345 g/mol |
| Topological Polar Surface Area (TPSA) | 301.00 Ų |
| XlogP | -2.50 |
| Atomic LogP (AlogP) | -1.00 |
| H-Bond Acceptor | 11 |
| H-Bond Donor | 12 |
| Rotatable Bonds | 32 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.9483 | 94.83% |
| Caco-2 | - | 0.8681 | 86.81% |
| Blood Brain Barrier | + | 0.5500 | 55.00% |
| Human oral bioavailability | - | 0.5857 | 58.57% |
| Subcellular localzation | Mitochondria | 0.4385 | 43.85% |
| OATP2B1 inhibitior | - | 0.7186 | 71.86% |
| OATP1B1 inhibitior | + | 0.8862 | 88.62% |
| OATP1B3 inhibitior | + | 0.9466 | 94.66% |
| MATE1 inhibitior | - | 0.8809 | 88.09% |
| OCT2 inhibitior | - | 0.8500 | 85.00% |
| BSEP inhibitior | + | 0.7239 | 72.39% |
| P-glycoprotein inhibitior | + | 0.7451 | 74.51% |
| P-glycoprotein substrate | + | 0.8174 | 81.74% |
| CYP3A4 substrate | + | 0.6715 | 67.15% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.7281 | 72.81% |
| CYP3A4 inhibition | - | 0.9840 | 98.40% |
| CYP2C9 inhibition | - | 0.9002 | 90.02% |
| CYP2C19 inhibition | - | 0.8897 | 88.97% |
| CYP2D6 inhibition | - | 0.9040 | 90.40% |
| CYP1A2 inhibition | - | 0.8868 | 88.68% |
| CYP2C8 inhibition | + | 0.5577 | 55.77% |
| CYP inhibitory promiscuity | - | 0.9101 | 91.01% |
| UGT catelyzed | + | 0.7000 | 70.00% |
| Carcinogenicity (binary) | - | 0.9300 | 93.00% |
| Carcinogenicity (trinary) | Non-required | 0.6937 | 69.37% |
| Eye corrosion | - | 0.9898 | 98.98% |
| Eye irritation | - | 0.9031 | 90.31% |
| Skin irritation | - | 0.7824 | 78.24% |
| Skin corrosion | - | 0.9366 | 93.66% |
| Ames mutagenesis | - | 0.5100 | 51.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.6465 | 64.65% |
| Micronuclear | + | 0.7200 | 72.00% |
| Hepatotoxicity | - | 0.6967 | 69.67% |
| skin sensitisation | - | 0.8916 | 89.16% |
| Respiratory toxicity | + | 0.7778 | 77.78% |
| Reproductive toxicity | + | 0.8929 | 89.29% |
| Mitochondrial toxicity | + | 0.8125 | 81.25% |
| Nephrotoxicity | - | 0.7311 | 73.11% |
| Acute Oral Toxicity (c) | III | 0.6397 | 63.97% |
| Estrogen receptor binding | + | 0.7556 | 75.56% |
| Androgen receptor binding | + | 0.6247 | 62.47% |
| Thyroid receptor binding | - | 0.4939 | 49.39% |
| Glucocorticoid receptor binding | - | 0.4694 | 46.94% |
| Aromatase binding | + | 0.6460 | 64.60% |
| PPAR gamma | + | 0.6855 | 68.55% |
| Honey bee toxicity | - | 0.8075 | 80.75% |
| Biodegradation | - | 0.7750 | 77.50% |
| Crustacea aquatic toxicity | + | 0.5500 | 55.00% |
| Fish aquatic toxicity | - | 0.8401 | 84.01% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.83% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 99.63% | 98.95% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 99.31% | 97.23% |
| CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 98.30% | 82.86% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.89% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.83% | 99.17% |
| CHEMBL5285 | Q99683 | Mitogen-activated protein kinase kinase kinase 5 | 95.91% | 92.26% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.84% | 94.45% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 95.64% | 90.20% |
| CHEMBL1829 | O15379 | Histone deacetylase 3 | 95.11% | 95.00% |
| CHEMBL4816 | Q9Y243 | Serine/threonine-protein kinase AKT3 | 94.44% | 96.28% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.51% | 95.56% |
| CHEMBL2973 | O75116 | Rho-associated protein kinase 2 | 93.48% | 96.73% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 91.91% | 89.33% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 91.72% | 98.05% |
| CHEMBL2535 | P11166 | Glucose transporter | 91.59% | 98.75% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 90.78% | 93.18% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 90.65% | 83.10% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 90.50% | 97.21% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 89.50% | 100.00% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 89.25% | 100.00% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 89.17% | 95.00% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 86.87% | 98.33% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 86.82% | 96.67% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.33% | 99.15% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 86.02% | 82.69% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 85.84% | 96.67% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 85.60% | 88.56% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.39% | 96.00% |
| CHEMBL3891 | P07384 | Calpain 1 | 84.77% | 93.04% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 83.86% | 97.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.80% | 94.73% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 83.45% | 94.75% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.67% | 91.19% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 82.60% | 98.24% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.58% | 95.50% |
| CHEMBL3836 | P53667 | LIM domain kinase 1 | 82.33% | 90.05% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.09% | 99.23% |
| CHEMBL3231 | Q13464 | Rho-associated protein kinase 1 | 81.87% | 95.55% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 81.73% | 95.17% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.24% | 97.09% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 81.12% | 91.38% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 80.86% | 94.80% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 80.56% | 85.00% |
| CHEMBL4237 | O75582 | Ribosomal protein S6 kinase alpha 5 | 80.34% | 91.00% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.15% | 100.00% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 80.14% | 93.10% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163068347 |
| LOTUS | LTS0036717 |
| wikiData | Q105340253 |