[3-[(5S,11aR)-3,11a-bis[(2S)-butan-2-yl]-4-hydroxy-2-methoxy-5-oxido-1-oxopyrazino[1,2-b][1,4,2]benzodioxazin-5-ium-9-yl]-2,4,5-triacetyloxy-6-(4-hydroxyphenyl)phenyl] acetate
| Internal ID | fe2de8f9-f186-433d-b5c2-aac968788883 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Tetracarboxylic acids and derivatives |
| IUPAC Name | [3-[(5S,11aR)-3,11a-bis[(2S)-butan-2-yl]-4-hydroxy-2-methoxy-5-oxido-1-oxopyrazino[1,2-b][1,4,2]benzodioxazin-5-ium-9-yl]-2,4,5-triacetyloxy-6-(4-hydroxyphenyl)phenyl] acetate |
| SMILES (Canonical) | CCC(C)C1=C([N+]2(C(C(=O)N1OC)(OC3=C(O2)C=CC(=C3)C4=C(C(=C(C(=C4OC(=O)C)OC(=O)C)C5=CC=C(C=C5)O)OC(=O)C)OC(=O)C)C(C)CC)[O-])O |
| SMILES (Isomeric) | CC[C@H](C)C1=C([N@+]2([C@@](C(=O)N1OC)(OC3=C(O2)C=CC(=C3)C4=C(C(=C(C(=C4OC(=O)C)OC(=O)C)C5=CC=C(C=C5)O)OC(=O)C)OC(=O)C)[C@@H](C)CC)[O-])O |
| InChI | InChI=1S/C39H42N2O15/c1-10-19(3)32-37(47)41(49)39(20(4)11-2,38(48)40(32)50-9)55-29-18-26(14-17-28(29)56-41)31-35(53-23(7)44)33(51-21(5)42)30(25-12-15-27(46)16-13-25)34(52-22(6)43)36(31)54-24(8)45/h12-20,46-47H,10-11H2,1-9H3/t19-,20-,39+,41-/m0/s1 |
| InChI Key | HTWYTTYCIDLWSF-RKFXEXHDSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C39H42N2O15 |
| Molecular Weight | 778.80 g/mol |
| Exact Mass | 778.25851864 g/mol |
| Topological Polar Surface Area (TPSA) | 212.00 Ų |
| XlogP | 5.60 |
| RefChem:928987 |
| (2,4,5-triacetyloxy-3-((1S,10R)-10,13-bis((2S)-butan-2-yl)-14-hydroxy-12-methoxy-1-oxido-11-oxo-2,9-dioxa-12-aza-1-azoniatricyclo(8.4.0.03,8)tetradec-13-en-6-yl)-6-(4-hydroxycyclohexyl)cyclohexyl) acetate |
| CHEBI:204187 |
| [3-[(5S,11aR)-3,11a-bis[(2S)-butan-2-yl]-4-hydroxy-2-methoxy-5-oxido-1-oxopyrazino[1,2-b][1,4,2]benzodioxazin-5-ium-9-yl]-2,4,5-triacetyloxy-6-(4-hydroxyphenyl)phenyl] acetate |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.63% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.73% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.60% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.38% | 91.11% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 95.61% | 97.21% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 94.66% | 92.29% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.56% | 85.14% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.02% | 86.33% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 92.40% | 94.73% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.35% | 89.00% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 90.95% | 95.17% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 90.84% | 96.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.67% | 99.17% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.59% | 94.00% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 88.92% | 95.71% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.11% | 99.15% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 87.76% | 90.00% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 84.74% | 92.68% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 83.63% | 93.40% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.56% | 95.56% |
| CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 82.30% | 95.64% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 82.11% | 93.10% |
| CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 81.81% | 95.53% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 81.36% | 96.77% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.71% | 90.71% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.11% | 93.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 46930121 |
| LOTUS | LTS0186521 |
| wikiData | Q77384445 |