3-(4-hydroxyphenyl)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4R,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-4-one
| Internal ID | 5a1059b6-b5b9-4fa8-825c-ffa5567015ef |
| Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Isoflavonoid O-glycosides |
| IUPAC Name | 3-(4-hydroxyphenyl)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4R,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-4-one |
| SMILES (Canonical) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=CC4=C(C=C3)C(=O)C(=CO4)C5=CC=C(C=C5)O)O)O)O)O)O)O |
| SMILES (Isomeric) | C[C@@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC3=CC4=C(C=C3)C(=O)C(=CO4)C5=CC=C(C=C5)O)O)O)O)O)O)O |
| InChI | InChI=1S/C27H30O13/c1-11-19(29)22(32)24(34)26(38-11)37-10-18-21(31)23(33)25(35)27(40-18)39-14-6-7-15-17(8-14)36-9-16(20(15)30)12-2-4-13(28)5-3-12/h2-9,11,18-19,21-29,31-35H,10H2,1H3/t11-,18-,19+,21-,22-,23+,24-,25-,26-,27-/m1/s1 |
| InChI Key | WMSFFKXKPQJZPN-MLJVYKSXSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C27H30O13 |
| Molecular Weight | 562.50 g/mol |
| Exact Mass | 562.16864101 g/mol |
| Topological Polar Surface Area (TPSA) | 205.00 Ų |
| XlogP | -1.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.46% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 98.20% | 98.95% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.94% | 89.00% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 95.40% | 91.49% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.83% | 86.33% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.67% | 94.00% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 94.08% | 98.35% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 92.17% | 91.71% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.00% | 99.15% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 90.99% | 86.92% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 90.85% | 95.93% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.79% | 99.17% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 88.76% | 95.78% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 88.62% | 93.31% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.55% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.44% | 95.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.81% | 97.09% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 87.17% | 95.89% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.17% | 94.73% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 85.04% | 97.36% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.38% | 95.89% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.92% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Deguelia scandens |
| PubChem | 163018227 |
| LOTUS | LTS0206721 |
| wikiData | Q105308814 |