[2,4-dihydroxy-3-[(E,1S,5S)-5-hydroxy-1,7-bis(4-hydroxyphenyl)hept-2-enyl]-6-methoxyphenyl]-[(2R,3R,4S,6S)-2-(4-hydroxyphenyl)-4-[(E)-2-(4-hydroxyphenyl)ethenyl]-6-[2-(4-hydroxyphenyl)ethyl]oxan-3-yl]methanone
Internal ID | d8346c30-2096-4ac0-8838-3949e79c0df3 |
Taxonomy | Phenylpropanoids and polyketides > Diarylheptanoids > Linear diarylheptanoids |
IUPAC Name | [2,4-dihydroxy-3-[(E,1S,5S)-5-hydroxy-1,7-bis(4-hydroxyphenyl)hept-2-enyl]-6-methoxyphenyl]-[(2R,3R,4S,6S)-2-(4-hydroxyphenyl)-4-[(E)-2-(4-hydroxyphenyl)ethenyl]-6-[2-(4-hydroxyphenyl)ethyl]oxan-3-yl]methanone |
SMILES (Canonical) | COC1=C(C(=C(C(=C1)O)C(C=CCC(CCC2=CC=C(C=C2)O)O)C3=CC=C(C=C3)O)O)C(=O)C4C(CC(OC4C5=CC=C(C=C5)O)CCC6=CC=C(C=C6)O)C=CC7=CC=C(C=C7)O |
SMILES (Isomeric) | COC1=C(C(=C(C(=C1)O)[C@@H](/C=C/C[C@H](CCC2=CC=C(C=C2)O)O)C3=CC=C(C=C3)O)O)C(=O)[C@@H]4[C@@H](C[C@@H](O[C@H]4C5=CC=C(C=C5)O)CCC6=CC=C(C=C6)O)/C=C/C7=CC=C(C=C7)O |
InChI | InChI=1S/C54H54O11/c1-64-48-32-47(61)50(46(36-15-26-43(59)27-16-36)4-2-3-39(55)19-6-34-9-22-41(57)23-10-34)53(63)51(48)52(62)49-38(14-5-33-7-20-40(56)21-8-33)31-45(30-13-35-11-24-42(58)25-12-35)65-54(49)37-17-28-44(60)29-18-37/h2,4-5,7-12,14-18,20-29,32,38-39,45-46,49,54-61,63H,3,6,13,19,30-31H2,1H3/b4-2+,14-5+/t38-,39-,45+,46+,49+,54+/m1/s1 |
InChI Key | ZSUGETUQFKRFKC-MXKSRXTFSA-N |
Popularity | 0 references in papers |
Molecular Formula | C54H54O11 |
Molecular Weight | 879.00 g/mol |
Exact Mass | 878.36661253 g/mol |
Topological Polar Surface Area (TPSA) | 197.00 Ų |
XlogP | 10.20 |
There are no found synonyms. |
![2D Structure of [2,4-dihydroxy-3-[(E,1S,5S)-5-hydroxy-1,7-bis(4-hydroxyphenyl)hept-2-enyl]-6-methoxyphenyl]-[(2R,3R,4S,6S)-2-(4-hydroxyphenyl)-4-[(E)-2-(4-hydroxyphenyl)ethenyl]-6-[2-(4-hydroxyphenyl)ethyl]oxan-3-yl]methanone 2D Structure of [2,4-dihydroxy-3-[(E,1S,5S)-5-hydroxy-1,7-bis(4-hydroxyphenyl)hept-2-enyl]-6-methoxyphenyl]-[(2R,3R,4S,6S)-2-(4-hydroxyphenyl)-4-[(E)-2-(4-hydroxyphenyl)ethenyl]-6-[2-(4-hydroxyphenyl)ethyl]oxan-3-yl]methanone](https://plantaedb.com/storage/docs/compounds/2023/11/9d2cf8a0-843b-11ee-9cfa-61763ba076cf.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.79% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.17% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.55% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.33% | 99.17% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 96.04% | 91.49% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.49% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.41% | 97.09% |
CHEMBL2581 | P07339 | Cathepsin D | 94.74% | 98.95% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 93.92% | 96.95% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 92.26% | 93.99% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.98% | 95.56% |
CHEMBL3194 | P02766 | Transthyretin | 91.75% | 90.71% |
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 91.58% | 97.31% |
CHEMBL5939 | Q9NZ08 | Endoplasmic reticulum aminopeptidase 1 | 91.21% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.45% | 95.89% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 90.32% | 95.50% |
CHEMBL2535 | P11166 | Glucose transporter | 89.71% | 98.75% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.61% | 89.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 89.53% | 95.89% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.30% | 96.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.94% | 94.73% |
CHEMBL4208 | P20618 | Proteasome component C5 | 88.83% | 90.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.73% | 90.71% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 88.71% | 97.21% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 87.22% | 92.94% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.88% | 91.19% |
CHEMBL1907 | P15144 | Aminopeptidase N | 85.15% | 93.31% |
CHEMBL5896 | O75164 | Lysine-specific demethylase 4A | 83.35% | 99.09% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.47% | 100.00% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 81.75% | 95.17% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 80.62% | 85.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Alpinia roxburghii |
PubChem | 10819468 |
LOTUS | LTS0130982 |
wikiData | Q105382729 |