methyl (3R,21S,22S)-11-ethyl-16-(hydroxymethylidene)-12,17,21,26-tetramethyl-4-oxo-22-[3-oxo-3-[(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enoxy]propyl]-7,23,24,25-tetrazahexacyclo[18.2.1.15,8.110,13.115,18.02,6]hexacosa-1,5(26),6,8,10(25),11,13,15(24),17,19-decaene-3-carboxylate
| Internal ID | fc2675da-0690-4243-ab1d-89455ed095b2 |
| Taxonomy | Organoheterocyclic compounds > Tetrapyrroles and derivatives |
| IUPAC Name | methyl (3R,21S,22S)-11-ethyl-16-(hydroxymethylidene)-12,17,21,26-tetramethyl-4-oxo-22-[3-oxo-3-[(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enoxy]propyl]-7,23,24,25-tetrazahexacyclo[18.2.1.15,8.110,13.115,18.02,6]hexacosa-1,5(26),6,8,10(25),11,13,15(24),17,19-decaene-3-carboxylate |
| SMILES (Canonical) | CCC1=C(C2=CC3=NC(=C(C3=CO)C)C=C4C(C(C(=C5C(C(=O)C6=C(C(=CC1=N2)N=C56)C)C(=O)OC)N4)CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C)C |
| SMILES (Isomeric) | CCC1=C(C2=CC3=NC(=C(C3=CO)C)C=C4[C@H]([C@@H](C(=C5[C@H](C(=O)C6=C(C(=CC1=N2)N=C56)C)C(=O)OC)N4)CCC(=O)OC/C=C(\C)/CCC[C@H](C)CCC[C@H](C)CCCC(C)C)C)C |
| InChI | InChI=1S/C54H72N4O6/c1-12-38-34(7)42-27-46-40(29-59)36(9)41(56-46)26-43-35(8)39(51(57-43)49-50(54(62)63-11)53(61)48-37(10)44(58-52(48)49)28-45(38)55-42)22-23-47(60)64-25-24-33(6)21-15-20-32(5)19-14-18-31(4)17-13-16-30(2)3/h24,26-32,35,39,50,57,59H,12-23,25H2,1-11H3/b33-24+,40-29?,42-27?,43-26?,44-28?,51-49?/t31-,32-,35+,39+,50-/m1/s1 |
| InChI Key | UBESZNCSUBYJLO-GQTGEKFLSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C54H72N4O6 |
| Molecular Weight | 873.20 g/mol |
| Exact Mass | 872.54518603 g/mol |
| Topological Polar Surface Area (TPSA) | 139.00 Ų |
| XlogP | 10.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.51% | 94.45% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.06% | 85.14% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.42% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.52% | 98.95% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 95.43% | 89.63% |
| CHEMBL202 | P00374 | Dihydrofolate reductase | 94.84% | 89.92% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 94.72% | 91.24% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.20% | 91.11% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 93.44% | 95.71% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 93.40% | 90.71% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 91.39% | 96.90% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.75% | 99.17% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 89.28% | 90.17% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 88.91% | 98.59% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.85% | 97.25% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.74% | 96.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.15% | 99.23% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 86.25% | 100.00% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 85.35% | 85.30% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 84.78% | 90.08% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 83.98% | 89.34% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 82.76% | 92.88% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 82.09% | 96.47% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.97% | 93.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.73% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 135410868 |
| LOTUS | LTS0200333 |
| wikiData | Q104392428 |