(2R,3R,4S,5S,6R)-2-[(2R)-4-[(1S,2S,4S,6R,7S,8R,9S,12S,13R,16S)-16-[(2R,3R,4R,5R,6R)-5-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-hydroxy-7,9,13-trimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-6-yl]-2-methylbutoxy]-6-(hydroxymethyl)oxane-3,4,5-triol
Internal ID | a6b13ae5-add0-4f7b-86a7-0250cd744198 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | (2R,3R,4S,5S,6R)-2-[(2R)-4-[(1S,2S,4S,6R,7S,8R,9S,12S,13R,16S)-16-[(2R,3R,4R,5R,6R)-5-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-hydroxy-7,9,13-trimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-6-yl]-2-methylbutoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | CC1C2C(CC3C2(CCC4C3CC=C5C4(CCC(C5)OC6C(C(C(C(O6)CO)OC7C(C(C(C(O7)CO)O)O)OC8C(C(C(C(O8)CO)O)O)O)O)O)C)C)OC1(CCC(C)COC9C(C(C(C(O9)CO)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@H]2[C@H](C[C@@H]3[C@@]2(CC[C@H]4[C@H]3CC=C5[C@@]4(CC[C@@H](C5)O[C@H]6[C@@H]([C@H]([C@H]([C@H](O6)CO)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O[C@H]8[C@@H]([C@H]([C@H]([C@H](O8)CO)O)O)O)O)O)C)C)O[C@@]1(CC[C@@H](C)CO[C@H]9[C@@H]([C@H]([C@@H]([C@H](O9)CO)O)O)O)O |
InChI | InChI=1S/C51H84O24/c1-20(19-67-45-40(63)36(59)33(56)28(15-52)69-45)7-12-51(66)21(2)32-27(75-51)14-26-24-6-5-22-13-23(8-10-49(22,3)25(24)9-11-50(26,32)4)68-46-42(65)39(62)43(31(18-55)72-46)73-48-44(38(61)35(58)30(17-54)71-48)74-47-41(64)37(60)34(57)29(16-53)70-47/h5,20-21,23-48,52-66H,6-19H2,1-4H3/t20-,21+,23+,24-,25+,26+,27+,28-,29-,30-,31-,32+,33-,34+,35-,36+,37+,38+,39-,40-,41-,42-,43+,44-,45-,46-,47+,48+,49+,50+,51-/m1/s1 |
InChI Key | LDZIXNUYSSMOPW-JEGADGNASA-N |
Popularity | 0 references in papers |
Molecular Formula | C51H84O24 |
Molecular Weight | 1081.20 g/mol |
Exact Mass | 1080.53525354 g/mol |
Topological Polar Surface Area (TPSA) | 387.00 Ų |
XlogP | -2.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.68% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.11% | 91.11% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 97.51% | 95.93% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.62% | 97.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 92.70% | 100.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.63% | 97.25% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.91% | 94.45% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 90.62% | 93.56% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 89.91% | 96.61% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 89.86% | 89.05% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.83% | 95.89% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 89.31% | 95.89% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 89.12% | 92.86% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.37% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 88.17% | 98.95% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 87.87% | 97.79% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 86.56% | 97.29% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 85.48% | 94.08% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 84.80% | 98.05% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 84.33% | 93.18% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.26% | 92.50% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.86% | 100.00% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 82.28% | 98.35% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 81.95% | 94.23% |
CHEMBL2360 | P00492 | Hypoxanthine-guanine phosphoribosyltransferase | 81.91% | 87.38% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 81.78% | 100.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.71% | 86.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.40% | 94.00% |
CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 81.16% | 98.46% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 80.51% | 95.00% |
CHEMBL237 | P41145 | Kappa opioid receptor | 80.14% | 98.10% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Tribulus terrestris |
PubChem | 101706915 |
LOTUS | LTS0201424 |
wikiData | Q105150462 |