3a,5a,5b,8,8,11a-Hexamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-7,9-diol
Internal ID | 0126f102-1321-4663-8e1e-542c664178bf |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | 3a,5a,5b,8,8,11a-hexamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-7,9-diol |
SMILES (Canonical) | CC(=C)C1CCC2(C1C3CCC4C5(CCC(C(C5C(CC4(C3(CC2)C)C)O)(C)C)O)C)C |
SMILES (Isomeric) | CC(=C)C1CCC2(C1C3CCC4C5(CCC(C(C5C(CC4(C3(CC2)C)C)O)(C)C)O)C)C |
InChI | InChI=1S/C30H50O2/c1-18(2)19-11-13-27(5)15-16-29(7)20(24(19)27)9-10-22-28(6)14-12-23(32)26(3,4)25(28)21(31)17-30(22,29)8/h19-25,31-32H,1,9-17H2,2-8H3 |
InChI Key | DSXMIKAVZFWLFV-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H50O2 |
Molecular Weight | 442.70 g/mol |
Exact Mass | 442.381080833 g/mol |
Topological Polar Surface Area (TPSA) | 40.50 Ų |
XlogP | 8.50 |
There are no found synonyms. |
![2D Structure of 3a,5a,5b,8,8,11a-Hexamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-7,9-diol 2D Structure of 3a,5a,5b,8,8,11a-Hexamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-7,9-diol](https://plantaedb.com/storage/docs/compounds/2023/11/9ac8fdf0-8569-11ee-93ac-67f5c36bd44d.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 94.78% | 96.61% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 93.90% | 96.38% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.47% | 94.45% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 92.40% | 92.94% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 92.31% | 82.69% |
CHEMBL4482 | O96013 | Serine/threonine-protein kinase PAK 4 | 91.14% | 95.42% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.36% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.23% | 96.09% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 87.91% | 94.75% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.60% | 97.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.47% | 100.00% |
CHEMBL2581 | P07339 | Cathepsin D | 85.84% | 98.95% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 85.35% | 95.38% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.95% | 95.89% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 84.34% | 95.58% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 82.99% | 97.79% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 82.08% | 85.14% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 81.79% | 90.17% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 81.43% | 97.50% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 81.36% | 91.11% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 81.24% | 92.86% |
CHEMBL1871 | P10275 | Androgen Receptor | 81.15% | 96.43% |
CHEMBL206 | P03372 | Estrogen receptor alpha | 80.91% | 97.64% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Drypetes inaequalis |
Drypetes tessmanniana |
Pleurostylia opposita |
Viburnum chingii |
PubChem | 74830164 |
LOTUS | LTS0153231 |
wikiData | Q104988105 |