15,16-Dimethoxy-10-methyl-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,13,15-heptaen-8-ol
| Internal ID | ceabc34f-56ca-4a10-b7c3-bdcd637c9432 |
| Taxonomy | Alkaloids and derivatives > Aporphines |
| IUPAC Name | 15,16-dimethoxy-10-methyl-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,13,15-heptaen-8-ol |
| SMILES (Canonical) | CN1CCC2=CC(=C(C3=C2C1=C(C4=CC=CC=C43)O)OC)OC |
| SMILES (Isomeric) | CN1CCC2=CC(=C(C3=C2C1=C(C4=CC=CC=C43)O)OC)OC |
| InChI | InChI=1S/C19H19NO3/c1-20-9-8-11-10-14(22-2)19(23-3)16-12-6-4-5-7-13(12)18(21)17(20)15(11)16/h4-7,10,21H,8-9H2,1-3H3 |
| InChI Key | FYQCXYMJSBZWPM-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.40 g/mol |
| Exact Mass | 309.13649347 g/mol |
| Topological Polar Surface Area (TPSA) | 41.90 Ų |
| XlogP | 4.20 |
| There are no found synonyms. |
![2D Structure of 15,16-Dimethoxy-10-methyl-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,13,15-heptaen-8-ol](https://plantaedb.com/storage/docs/compounds/2023/11/9a87ece0-832c-11ee-94ca-f78756c7a695.jpg "2D Structure of 15,16-Dimethoxy-10-methyl-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,13,15-heptaen-8-ol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.60% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.83% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.29% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.80% | 86.33% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 94.63% | 93.99% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 93.36% | 91.00% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 92.27% | 91.49% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 90.51% | 90.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.22% | 89.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.17% | 94.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 86.42% | 98.75% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.68% | 95.89% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 85.38% | 95.62% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.42% | 98.95% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 83.46% | 93.65% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 83.44% | 92.98% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 81.58% | 92.67% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.05% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Nelumbo nucifera |
| PubChem | 122210734 |
| LOTUS | LTS0193508 |
| wikiData | Q105004634 |