(3aR,5R,7R,8Z,9aR)-5-[(E,1R)-1-chlorohex-3-en-5-ynyl]-7-ethyl-2,2-dimethyl-4,5,7,9a-tetrahydro-3aH-[1,3]dioxolo[4,5-d]oxocine
| Internal ID | 376eb86b-0608-44a0-9777-1c11f93b6d53 |
| Taxonomy | Organoheterocyclic compounds > Oxocins |
| IUPAC Name | (3aR,5R,7R,8Z,9aR)-5-[(E,1R)-1-chlorohex-3-en-5-ynyl]-7-ethyl-2,2-dimethyl-4,5,7,9a-tetrahydro-3aH-[1,3]dioxolo[4,5-d]oxocine |
| SMILES (Canonical) | CCC1C=CC2C(CC(O1)C(CC=CC#C)Cl)OC(O2)(C)C |
| SMILES (Isomeric) | CC[C@@H]1/C=C\[C@@H]2[C@@H](C[C@@H](O1)[C@@H](C/C=C/C#C)Cl)OC(O2)(C)C |
| InChI | InChI=1S/C18H25ClO3/c1-5-7-8-9-14(19)16-12-17-15(21-18(3,4)22-17)11-10-13(6-2)20-16/h1,7-8,10-11,13-17H,6,9,12H2,2-4H3/b8-7+,11-10-/t13-,14-,15-,16-,17-/m1/s1 |
| InChI Key | RSWOZFQIXHUZTF-SRISBAHASA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C18H25ClO3 |
| Molecular Weight | 324.80 g/mol |
| Exact Mass | 324.1492223 g/mol |
| Topological Polar Surface Area (TPSA) | 27.70 Ų |
| XlogP | 3.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 95.84% | 90.17% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.58% | 91.11% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 95.57% | 89.63% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.22% | 96.09% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 91.42% | 94.73% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.74% | 97.25% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.00% | 97.09% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 88.73% | 91.49% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.36% | 86.33% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.71% | 94.45% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 84.47% | 96.61% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.61% | 95.56% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.23% | 97.14% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 81.08% | 100.00% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 80.91% | 95.93% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163098997 |
| LOTUS | LTS0123604 |
| wikiData | Q105244927 |