(1S,2R,5R,8S,9R,10R,11S,15R,16R,18S)-9,10,15,18-tetrahydroxy-12,12-dimethyl-16-(3-methylbutoxy)-6-methylidene-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-7-one
Internal ID | 3164760d-9a43-4c2e-b71a-bf6070034df0 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Kaurane diterpenoids |
IUPAC Name | (1S,2R,5R,8S,9R,10R,11S,15R,16R,18S)-9,10,15,18-tetrahydroxy-12,12-dimethyl-16-(3-methylbutoxy)-6-methylidene-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-7-one |
SMILES (Canonical) | CC(C)CCOC1C23C4CCC5C(C4(C(=O)C5=C)C(O1)(C(C2C(CCC3O)(C)C)O)O)O |
SMILES (Isomeric) | CC(C)CCO[C@H]1[C@@]23[C@H]4CC[C@H]5[C@@H]([C@@]4(C(=O)C5=C)[C@@](O1)([C@@H]([C@H]2C(CC[C@H]3O)(C)C)O)O)O |
InChI | InChI=1S/C25H38O7/c1-12(2)9-11-31-21-23-15-7-6-14-13(3)18(27)24(15,19(14)28)25(30,32-21)20(29)17(23)22(4,5)10-8-16(23)26/h12,14-17,19-21,26,28-30H,3,6-11H2,1-2,4-5H3/t14-,15-,16-,17+,19+,20-,21-,23-,24-,25+/m1/s1 |
InChI Key | MMNKLYKGGXUNID-QKIPNZDQSA-N |
Popularity | 0 references in papers |
Molecular Formula | C25H38O7 |
Molecular Weight | 450.60 g/mol |
Exact Mass | 450.26175355 g/mol |
Topological Polar Surface Area (TPSA) | 116.00 Ų |
XlogP | 1.80 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 96.55% | 98.95% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 95.90% | 96.61% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.80% | 94.45% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.83% | 97.25% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 93.71% | 90.17% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.24% | 97.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.02% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.78% | 96.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.33% | 95.89% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 89.17% | 96.77% |
CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 85.82% | 95.34% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.96% | 92.62% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 84.56% | 90.08% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.55% | 97.14% |
CHEMBL3837 | P07711 | Cathepsin L | 81.06% | 96.61% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.01% | 91.19% |
CHEMBL5957 | P21589 | 5'-nucleotidase | 80.00% | 97.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Isodon rubescens |
PubChem | 162964437 |
LOTUS | LTS0138791 |
wikiData | Q105167914 |