5-hydroxy-2-[2-hydroxy-3-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-7,8-dimethoxychromen-4-one
Internal ID | d81e12a9-14be-4581-aa81-03b622220078 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides |
IUPAC Name | 5-hydroxy-2-[2-hydroxy-3-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-7,8-dimethoxychromen-4-one |
SMILES (Canonical) | COC1=C(C2=C(C(=C1)O)C(=O)C=C(O2)C3=C(C(=CC=C3)OC4C(C(C(C(O4)CO)O)O)O)O)OC |
SMILES (Isomeric) | COC1=C(C2=C(C(=C1)O)C(=O)C=C(O2)C3=C(C(=CC=C3)O[C@H]4[C@@H]([C@@H]([C@@H]([C@H](O4)CO)O)O)O)O)OC |
InChI | InChI=1S/C23H24O12/c1-31-14-7-11(26)16-10(25)6-13(33-22(16)21(14)32-2)9-4-3-5-12(17(9)27)34-23-20(30)19(29)18(28)15(8-24)35-23/h3-7,15,18-20,23-24,26-30H,8H2,1-2H3/t15-,18-,19-,20-,23-/m1/s1 |
InChI Key | JCUIPEIMZRLNKQ-PVIGCVSNSA-N |
Popularity | 0 references in papers |
Molecular Formula | C23H24O12 |
Molecular Weight | 492.40 g/mol |
Exact Mass | 492.12677620 g/mol |
Topological Polar Surface Area (TPSA) | 185.00 Ų |
XlogP | 0.80 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.09% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 97.13% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.44% | 94.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.17% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.74% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.15% | 95.56% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.78% | 99.17% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 91.07% | 96.21% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 87.96% | 95.83% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.47% | 96.09% |
CHEMBL3194 | P02766 | Transthyretin | 86.90% | 90.71% |
CHEMBL2535 | P11166 | Glucose transporter | 85.85% | 98.75% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.05% | 95.89% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.49% | 94.73% |
CHEMBL1907 | P15144 | Aminopeptidase N | 83.99% | 93.31% |
CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 83.42% | 94.03% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.31% | 99.23% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.92% | 96.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 82.75% | 85.14% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 82.23% | 91.49% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 81.39% | 91.24% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 80.73% | 90.20% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 80.57% | 99.15% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Andrographis paniculata |
PubChem | 21550410 |
LOTUS | LTS0182457 |
wikiData | Q105125119 |