2-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-4a,8a-dihydrochromen-4-one
Internal ID | 3c0ccb44-52b5-43c4-b6c6-e120e0200c42 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > O-glycosyl compounds |
IUPAC Name | 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-4a,8a-dihydrochromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2=C(OC3C=C(C=C(C3C2=O)O)O)C4=CC(=C(C=C4)O)O)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OC2=C(OC3C=C(C=C(C3C2=O)O)O)C4=CC(=C(C=C4)O)O)O)O)O |
InChI | InChI=1S/C21H22O11/c1-7-15(26)17(28)18(29)21(30-7)32-20-16(27)14-12(25)5-9(22)6-13(14)31-19(20)8-2-3-10(23)11(24)4-8/h2-7,13-15,17-18,21-26,28-29H,1H3 |
InChI Key | YMWQJWDDCRWVFO-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H22O11 |
Molecular Weight | 450.40 g/mol |
Exact Mass | 450.11621151 g/mol |
Topological Polar Surface Area (TPSA) | 186.00 Ų |
XlogP | -0.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1951 | P21397 | Monoamine oxidase A | 98.83% | 91.49% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.64% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.76% | 86.33% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.65% | 85.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.47% | 95.56% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 95.36% | 97.36% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 95.05% | 99.15% |
CHEMBL2581 | P07339 | Cathepsin D | 93.38% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.31% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.97% | 94.00% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 88.53% | 93.40% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.17% | 96.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.70% | 94.73% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 87.13% | 93.65% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 86.08% | 83.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.92% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Maesa lanceolata |
PubChem | 162846308 |
LOTUS | LTS0115513 |
wikiData | Q105350776 |