[(2R,3R)-8-[(2R,3S,4S)-5,7-dihydroxy-2-(4-hydroxyphenyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-3,4-dihydro-2H-chromen-4-yl]-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3,4-dihydro-2H-chromen-3-yl] 4-hydroxy-3,5-dimethoxybenzoate
| Internal ID | bfdf9298-13ae-4285-9102-440157da663f |
| Taxonomy | Phenylpropanoids and polyketides > Tannins > Complex tannins |
| IUPAC Name | [(2R,3R)-8-[(2R,3S,4S)-5,7-dihydroxy-2-(4-hydroxyphenyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-3,4-dihydro-2H-chromen-4-yl]-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3,4-dihydro-2H-chromen-3-yl] 4-hydroxy-3,5-dimethoxybenzoate |
| SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C3=C(C=C(C=C3OC2C4=CC=C(C=C4)O)O)O)C5=C(C=C(C6=C5OC(C(C6)OC(=O)C7=CC(=C(C(=C7)OC)O)OC)C8=CC(=C(C=C8)O)O)O)O)O)O)O |
| SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@H]2[C@@H](C3=C(C=C(C=C3O[C@@H]2C4=CC=C(C=C4)O)O)O)C5=C(C=C(C6=C5O[C@@H]([C@@H](C6)OC(=O)C7=CC(=C(C(=C7)OC)O)OC)C8=CC(=C(C=C8)O)O)O)O)O)O)O |
| InChI | InChI=1S/C45H44O19/c1-17-36(53)38(55)39(56)45(60-17)64-43-35(33-27(51)13-22(47)14-29(33)61-41(43)18-4-7-21(46)8-5-18)34-28(52)16-25(49)23-15-32(40(63-42(23)34)19-6-9-24(48)26(50)10-19)62-44(57)20-11-30(58-2)37(54)31(12-20)59-3/h4-14,16-17,32,35-36,38-41,43,45-56H,15H2,1-3H3/t17-,32+,35-,36-,38+,39+,40+,41+,43-,45-/m0/s1 |
| InChI Key | XBTJDIMYLZJUFV-XKJIMSKFSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C45H44O19 |
| Molecular Weight | 888.80 g/mol |
| Exact Mass | 888.24767917 g/mol |
| Topological Polar Surface Area (TPSA) | 304.00 Ų |
| XlogP | 3.40 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.52% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 98.00% | 91.49% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.93% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.39% | 86.33% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.52% | 89.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 93.59% | 90.00% |
| CHEMBL3194 | P02766 | Transthyretin | 93.31% | 90.71% |
| CHEMBL2535 | P11166 | Glucose transporter | 92.73% | 98.75% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.36% | 99.17% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 91.75% | 97.36% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.64% | 98.95% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.58% | 99.23% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.23% | 95.56% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.01% | 94.00% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 86.88% | 97.53% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.16% | 97.09% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.04% | 95.89% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 84.37% | 97.33% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 84.22% | 82.38% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.49% | 94.73% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.30% | 90.71% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.17% | 96.00% |
| CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 81.16% | 97.31% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Joannesia princeps |
| PubChem | 162911917 |
| LOTUS | LTS0057568 |
| wikiData | Q105324670 |