(9,9-dimethyl-2-oxo-3,4-dihydropyrano[2,3-g]chromen-3-yl) (Z)-2-methylbut-2-enoate
| Internal ID | c98b4e55-f698-490b-b20f-44f4878ac51c |
| Taxonomy | Phenylpropanoids and polyketides > Coumarins and derivatives > Pyranocoumarins > Linear pyranocoumarins |
| IUPAC Name | (9,9-dimethyl-2-oxo-3,4-dihydropyrano[2,3-g]chromen-3-yl) (Z)-2-methylbut-2-enoate |
| SMILES (Canonical) | CC=C(C)C(=O)OC1CC2=CC3=C(C=C2OC1=O)C(C=CO3)(C)C |
| SMILES (Isomeric) | C/C=C(/C)\C(=O)OC1CC2=CC3=C(C=C2OC1=O)C(C=CO3)(C)C |
| InChI | InChI=1S/C19H20O5/c1-5-11(2)17(20)24-16-9-12-8-15-13(10-14(12)23-18(16)21)19(3,4)6-7-22-15/h5-8,10,16H,9H2,1-4H3/b11-5- |
| InChI Key | GRMGLFLWIKMFAE-WZUFQYTHSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H20O5 |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.13107373 g/mol |
| Topological Polar Surface Area (TPSA) | 61.80 Ų |
| XlogP | 4.10 |
| There are no found synonyms. |
![2D Structure of (9,9-dimethyl-2-oxo-3,4-dihydropyrano[2,3-g]chromen-3-yl) (Z)-2-methylbut-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/99-dimethyl-2-oxo-34-dihydropyrano23-gchromen-3-yl-z-2-methylbut-2-enoate.jpg "2D Structure of (9,9-dimethyl-2-oxo-3,4-dihydropyrano[2,3-g]chromen-3-yl) (Z)-2-methylbut-2-enoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.45% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.46% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.44% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.97% | 86.33% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.94% | 89.00% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.53% | 91.19% |
| CHEMBL2581 | P07339 | Cathepsin D | 88.03% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.61% | 95.56% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.23% | 99.17% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.87% | 95.89% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.83% | 100.00% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.54% | 92.94% |
| CHEMBL2964 | P36507 | Dual specificity mitogen-activated protein kinase kinase 2 | 81.64% | 80.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.30% | 99.23% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 80.05% | 95.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Angelica gigas |
| Phlojodicarpus villosus |
| Zosima korovinii |
| PubChem | 15596603 |
| LOTUS | LTS0192896 |
| wikiData | Q104395441 |