5,7-dihydroxy-2-[3-hydroxy-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]chromen-4-one
Internal ID | 584896c1-4b29-4f05-9bf2-565bde029426 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides |
IUPAC Name | 5,7-dihydroxy-2-[3-hydroxy-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]chromen-4-one |
SMILES (Canonical) | C1=CC(=C(C=C1C2=CC(=O)C3=C(C=C(C=C3O2)O)O)O)OC4C(C(C(C(O4)CO)O)O)O |
SMILES (Isomeric) | C1=CC(=C(C=C1C2=CC(=O)C3=C(C=C(C=C3O2)O)O)O)O[C@@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O |
InChI | InChI=1S/C21H20O11/c22-7-16-18(27)19(28)20(29)21(32-16)31-13-2-1-8(3-10(13)24)14-6-12(26)17-11(25)4-9(23)5-15(17)30-14/h1-6,16,18-25,27-29H,7H2/t16-,18-,19+,20-,21+/m1/s1 |
InChI Key | UHNXUSWGOJMEFO-RQXATKFSSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C21H20O11 |
Molecular Weight | 448.40 g/mol |
Exact Mass | 448.10056145 g/mol |
Topological Polar Surface Area (TPSA) | 186.00 Ų |
XlogP | 0.50 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.30% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.26% | 89.00% |
CHEMBL3194 | P02766 | Transthyretin | 95.69% | 90.71% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.59% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 95.57% | 98.95% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 94.59% | 83.57% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 93.11% | 95.78% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 92.10% | 86.92% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 89.01% | 96.21% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.65% | 99.15% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 88.36% | 91.49% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.87% | 86.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.30% | 97.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.41% | 94.73% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.61% | 99.17% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.52% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.15% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.79% | 96.09% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.36% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Artemisia judaica |
PubChem | 67128659 |
LOTUS | LTS0082709 |
wikiData | Q105273004 |