(5S,8R,9S,10S,13R,14S,17R)-17-[(E,2R,5S)-5-ethyl-6-methylhept-3-en-2-yl]-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one
Internal ID | b1a8017b-79f9-44cf-b7e5-1289926b31f0 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Stigmastanes and derivatives |
IUPAC Name | (5S,8R,9S,10S,13R,14S,17R)-17-[(E,2R,5S)-5-ethyl-6-methylhept-3-en-2-yl]-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one |
SMILES (Canonical) | CCC(C=CC(C)C1CCC2C1(CCC3C2CCC4C3(CCC(=O)C4)C)C)C(C)C |
SMILES (Isomeric) | CC[C@H](/C=C/[C@@H](C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC[C@@H]4[C@@]3(CCC(=O)C4)C)C)C(C)C |
InChI | InChI=1S/C29H48O/c1-7-21(19(2)3)9-8-20(4)25-12-13-26-24-11-10-22-18-23(30)14-16-28(22,5)27(24)15-17-29(25,26)6/h8-9,19-22,24-27H,7,10-18H2,1-6H3/b9-8+/t20-,21-,22+,24+,25-,26+,27+,28+,29-/m1/s1 |
InChI Key | RTLUSWHIKFIQFU-FFANMRNWSA-N |
Popularity | 0 references in papers |
Molecular Formula | C29H48O |
Molecular Weight | 412.70 g/mol |
Exact Mass | 412.370516150 g/mol |
Topological Polar Surface Area (TPSA) | 17.10 Ų |
XlogP | 9.00 |
There are no found synonyms. |
![2D Structure of (5S,8R,9S,10S,13R,14S,17R)-17-[(E,2R,5S)-5-ethyl-6-methylhept-3-en-2-yl]-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one 2D Structure of (5S,8R,9S,10S,13R,14S,17R)-17-[(E,2R,5S)-5-ethyl-6-methylhept-3-en-2-yl]-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one](https://plantaedb.com/storage/docs/compounds/2023/11/98d968a0-8597-11ee-8f63-45f64b9de68e.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.23% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.48% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 95.35% | 98.95% |
CHEMBL236 | P41143 | Delta opioid receptor | 93.84% | 99.35% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.17% | 94.45% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.38% | 100.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.81% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.37% | 95.56% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 89.18% | 96.38% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.95% | 91.11% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.74% | 90.71% |
CHEMBL1871 | P10275 | Androgen Receptor | 87.91% | 96.43% |
CHEMBL5600 | P27448 | Serine/threonine-protein kinase c-TAK1 | 86.54% | 88.81% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.14% | 90.17% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 86.05% | 95.89% |
CHEMBL299 | P17252 | Protein kinase C alpha | 85.64% | 98.03% |
CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 85.60% | 85.30% |
CHEMBL202 | P00374 | Dihydrofolate reductase | 85.16% | 89.92% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 84.35% | 85.11% |
CHEMBL1902 | P62942 | FK506-binding protein 1A | 84.30% | 97.05% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 83.13% | 96.77% |
CHEMBL204 | P00734 | Thrombin | 83.00% | 96.01% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 81.56% | 92.86% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.55% | 93.56% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.90% | 100.00% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 80.61% | 82.69% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 80.01% | 96.47% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Gynura japonica |
Rhinacanthus nasutus |
PubChem | 99572222 |
LOTUS | LTS0129192 |
wikiData | Q105245229 |