(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[[(4S,5S,8R,9R,12S,13S,16S)-5,9,17,17-tetramethyl-8-[(2R,4E)-6-methylhepta-4,6-dien-2-yl]-18-oxapentacyclo[10.5.2.01,13.04,12.05,9]nonadec-2-en-16-yl]oxy]oxane-3,4,5-triol
Internal ID | 4ac625a0-c077-446f-a1f7-a148532a9b1b |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Cucurbitacins |
IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[[(4S,5S,8R,9R,12S,13S,16S)-5,9,17,17-tetramethyl-8-[(2R,4E)-6-methylhepta-4,6-dien-2-yl]-18-oxapentacyclo[10.5.2.01,13.04,12.05,9]nonadec-2-en-16-yl]oxy]oxane-3,4,5-triol |
SMILES (Canonical) | CC(CC=CC(=C)C)C1CCC2(C1(CCC34C2C=CC5(C3CCC(C5(C)C)OC6C(C(C(C(O6)CO)O)O)O)OC4)C)C |
SMILES (Isomeric) | C[C@H](C/C=C/C(=C)C)[C@H]1CC[C@@]2([C@@]1(CC[C@]34[C@H]2C=CC5([C@H]3CC[C@@H](C5(C)C)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O)OC4)C)C |
InChI | InChI=1S/C36H56O7/c1-21(2)9-8-10-22(3)23-13-15-34(7)25-14-16-36-26(35(25,20-41-36)18-17-33(23,34)6)11-12-27(32(36,4)5)43-31-30(40)29(39)28(38)24(19-37)42-31/h8-9,14,16,22-31,37-40H,1,10-13,15,17-20H2,2-7H3/b9-8+/t22-,23-,24-,25+,26+,27+,28-,29+,30-,31+,33-,34+,35+,36?/m1/s1 |
InChI Key | QFMGCFIFVIVJLB-CEIAHLHVSA-N |
Popularity | 0 references in papers |
Molecular Formula | C36H56O7 |
Molecular Weight | 600.80 g/mol |
Exact Mass | 600.40260412 g/mol |
Topological Polar Surface Area (TPSA) | 109.00 Ų |
XlogP | 6.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.40% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.36% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.64% | 94.45% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 94.49% | 95.89% |
CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 93.89% | 97.47% |
CHEMBL2581 | P07339 | Cathepsin D | 93.76% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.68% | 97.09% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 90.27% | 100.00% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 87.96% | 91.03% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 87.32% | 97.28% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 87.08% | 91.24% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 86.92% | 100.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.66% | 86.33% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 86.02% | 93.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 85.71% | 91.49% |
CHEMBL3286 | P00749 | Urokinase-type plasminogen activator | 85.66% | 97.88% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.94% | 95.56% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 84.63% | 97.25% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.52% | 89.00% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 84.47% | 89.05% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.11% | 92.62% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 84.07% | 96.21% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 83.87% | 89.50% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 83.58% | 92.86% |
CHEMBL2094128 | P24941 | Cyclin-dependent kinase 2/cyclin A | 83.25% | 97.25% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 83.21% | 100.00% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 82.62% | 96.61% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 82.49% | 96.47% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.38% | 100.00% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 82.13% | 95.83% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 81.11% | 96.77% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 80.90% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Momordica charantia |
PubChem | 163194578 |
LOTUS | LTS0138121 |
wikiData | Q105219650 |