[(1S,2S,3R,4S,7R,9S,10S,12R,15S)-4,12-diacetyloxy-1,9,15-trihydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.0^{3,10.0^{4,7]heptadec-13-en-2-yl] benzoate
Internal ID | 65ada658-2dc6-402f-8ceb-4b91584ea540 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Taxanes and derivatives |
IUPAC Name | (4,12-diacetyloxy-1,9,15-trihydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl) benzoate |
SMILES (Canonical) | CC1=C2C(C(=O)C3(C(CC4C(C3C(C(C2(C)C)(CC1O)O)OC(=O)C5=CC=CC=C5)(CO4)OC(=O)C)O)C)OC(=O)C |
SMILES (Isomeric) | CC1=C2C(C(=O)C3(C(CC4C(C3C(C(C2(C)C)(CC1O)O)OC(=O)C5=CC=CC=C5)(CO4)OC(=O)C)O)C)OC(=O)C |
InChI | InChI=1S/C31H38O11/c1-15-19(34)13-31(38)26(41-27(37)18-10-8-7-9-11-18)24-29(6,20(35)12-21-30(24,14-39-21)42-17(3)33)25(36)23(40-16(2)32)22(15)28(31,4)5/h7-11,19-21,23-24,26,34-35,38H,12-14H2,1-6H3 |
InChI Key | OVMSOCFBDVBLFW-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C31H38O11 |
Molecular Weight | 586.60 g/mol |
Exact Mass | 586.24141202 g/mol |
Topological Polar Surface Area (TPSA) | 166.00 Ų |
XlogP | 1.20 |
LS-15311 |
[(1S,2S,3R,4S,7R,9S,10S,12R,15S)-4,12-diacetyloxy-1,9,15-trihydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.0^{3,10.0^{4,7]heptadec-13-en-2-yl] benzoate |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.84% | 86.33% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 96.77% | 90.17% |
CHEMBL2581 | P07339 | Cathepsin D | 96.54% | 98.95% |
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 94.62% | 81.11% |
CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 94.17% | 87.67% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.40% | 95.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.35% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.19% | 96.09% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 92.25% | 91.49% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 90.49% | 95.50% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.66% | 97.09% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 89.15% | 94.62% |
CHEMBL5028 | O14672 | ADAM10 | 88.91% | 97.50% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 88.11% | 83.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.42% | 99.23% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.94% | 90.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.51% | 91.19% |
CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 85.49% | 89.44% |
CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 83.51% | 92.67% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 83.48% | 82.69% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.28% | 97.14% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 82.24% | 90.24% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 82.22% | 94.08% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.79% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Taxus baccata |
PubChem | 4357887 |
LOTUS | LTS0205194 |
wikiData | Q105200844 |