[(1S,2S,3S,7S,8R,9R,10R,11S,12Z,14S,17R)-2,9,11-triacetyloxy-10-hydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadeca-4,12-dien-7-yl] acetate
| Internal ID | d1fe2709-cb09-4f9f-956e-8964f9041088 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Diterpene lactones |
| IUPAC Name | [(1S,2S,3S,7S,8R,9R,10R,11S,12Z,14S,17R)-2,9,11-triacetyloxy-10-hydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadeca-4,12-dien-7-yl] acetate |
| SMILES (Canonical) | CC1=CCC(C2(C1C(C34C(C=C(C(C(C2OC(=O)C)O)OC(=O)C)C)OC(=O)C3(O4)C)OC(=O)C)C)OC(=O)C |
| SMILES (Isomeric) | CC1=CC[C@@H]([C@]2([C@H]1[C@@H]([C@@]34[C@H](/C=C(\[C@@H]([C@H]([C@@H]2OC(=O)C)O)OC(=O)C)/C)OC(=O)[C@@]3(O4)C)OC(=O)C)C)OC(=O)C |
| InChI | InChI=1S/C28H36O12/c1-12-9-10-18(35-14(3)29)26(7)20(12)23(37-16(5)31)28-19(39-25(34)27(28,8)40-28)11-13(2)22(36-15(4)30)21(33)24(26)38-17(6)32/h9,11,18-24,33H,10H2,1-8H3/b13-11-/t18-,19-,20+,21+,22-,23-,24-,26-,27-,28-/m0/s1 |
| InChI Key | IDRQERODDPDPHL-UPMYMEJDSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C28H36O12 |
| Molecular Weight | 564.60 g/mol |
| Exact Mass | 564.22067658 g/mol |
| Topological Polar Surface Area (TPSA) | 164.00 Ų |
| XlogP | 0.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.72% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.68% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.33% | 94.45% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.52% | 95.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.69% | 89.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.36% | 98.95% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.95% | 99.23% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.54% | 86.33% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.32% | 97.25% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.10% | 94.00% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 85.68% | 81.11% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.73% | 91.19% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 81.72% | 96.77% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.99% | 97.14% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.87% | 97.09% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.08% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 11238387 |
| LOTUS | LTS0070707 |
| wikiData | Q105111477 |