[2,4,5-Tris[(3,4,5-trihydroxybenzoyl)oxy]-6-[(3,4,5-trihydroxybenzoyl)oxymethyl]oxan-3-yl] 2-[[31-(1,1-dihydroxy-2-oxobut-3-enyl)-14,15,18,19,20,31,34,35-octahydroxy-2,10,23,28-tetraoxo-5-(3,4,5-trihydroxybenzoyl)oxy-3,6,9,24,27,32-hexaoxaheptacyclo[28.6.1.04,25.07,26.011,16.017,22.033,37]heptatriaconta-1(36),11,13,15,17,19,21,33(37),34-nonaen-13-yl]oxy]-3,4,5-trihydroxybenzoate
Internal ID | 9eccf7f0-7beb-4af1-b407-3af4f356601e |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | [2,4,5-tris[(3,4,5-trihydroxybenzoyl)oxy]-6-[(3,4,5-trihydroxybenzoyl)oxymethyl]oxan-3-yl] 2-[[31-(1,1-dihydroxy-2-oxobut-3-enyl)-14,15,18,19,20,31,34,35-octahydroxy-2,10,23,28-tetraoxo-5-(3,4,5-trihydroxybenzoyl)oxy-3,6,9,24,27,32-hexaoxaheptacyclo[28.6.1.04,25.07,26.011,16.017,22.033,37]heptatriaconta-1(36),11,13,15,17,19,21,33(37),34-nonaen-13-yl]oxy]-3,4,5-trihydroxybenzoate |
SMILES (Canonical) | C=CC(=O)C(C1(C2CC(=O)OC3C4COC(=O)C5=CC(=C(C(=C5C6=C(C(=C(C=C6C(=O)OC3C(C(O4)OC(=O)C7=CC(=C(C(=C7)O)O)O)OC(=O)C8=CC(=C(C(=C28)O1)O)O)O)O)O)O)O)OC9=C(C(=C(C=C9C(=O)OC1C(C(C(OC1OC(=O)C1=CC(=C(C(=C1)O)O)O)COC(=O)C1=CC(=C(C(=C1)O)O)O)OC(=O)C1=CC(=C(C(=C1)O)O)O)OC(=O)C1=CC(=C(C(=C1)O)O)O)O)O)O)O)(O)O |
SMILES (Isomeric) | C=CC(=O)C(C1(C2CC(=O)OC3C4COC(=O)C5=CC(=C(C(=C5C6=C(C(=C(C=C6C(=O)OC3C(C(O4)OC(=O)C7=CC(=C(C(=C7)O)O)O)OC(=O)C8=CC(=C(C(=C28)O1)O)O)O)O)O)O)O)OC9=C(C(=C(C=C9C(=O)OC1C(C(C(OC1OC(=O)C1=CC(=C(C(=C1)O)O)O)COC(=O)C1=CC(=C(C(=C1)O)O)O)OC(=O)C1=CC(=C(C(=C1)O)O)O)OC(=O)C1=CC(=C(C(=C1)O)O)O)O)O)O)O)(O)O |
InChI | InChI=1S/C83H62O53/c1-2-46(97)82(120,121)83(122)29-17-47(98)128-64-44-19-124-76(116)27-16-43(59(107)61(109)50(27)49-26(14-40(94)56(104)60(49)108)78(118)131-67(64)69(132-77(117)25-13-42(96)58(106)66(136-83)48(25)29)80(126-44)134-74(114)23-9-36(90)54(102)37(91)10-23)125-63-28(15-41(95)57(105)62(63)110)79(119)133-70-68(130-73(113)22-7-34(88)53(101)35(89)8-22)65(129-72(112)21-5-32(86)52(100)33(87)6-21)45(18-123-71(111)20-3-30(84)51(99)31(85)4-20)127-81(70)135-75(115)24-11-38(92)55(103)39(93)12-24/h2-16,29,44-45,64-65,67-70,80-81,84-96,99-110,120-122H,1,17-19H2 |
InChI Key | FTNAKGQDYHTLFM-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C83H62O53 |
Molecular Weight | 1907.30 g/mol |
Exact Mass | 1906.2156268 g/mol |
Topological Polar Surface Area (TPSA) | 883.00 Ų |
XlogP | 3.10 |
There are no found synonyms. |
![2D Structure of [2,4,5-Tris[(3,4,5-trihydroxybenzoyl)oxy]-6-[(3,4,5-trihydroxybenzoyl)oxymethyl]oxan-3-yl] 2-[[31-(1,1-dihydroxy-2-oxobut-3-enyl)-14,15,18,19,20,31,34,35-octahydroxy-2,10,23,28-tetraoxo-5-(3,4,5-trihydroxybenzoyl)oxy-3,6,9,24,27,32-hexaoxaheptacyclo[28.6.1.04,25.07,26.011,16.017,22.033,37]heptatriaconta-1(36),11,13,15,17,19,21,33(37),34-nonaen-13-yl]oxy]-3,4,5-trihydroxybenzoate 2D Structure of [2,4,5-Tris[(3,4,5-trihydroxybenzoyl)oxy]-6-[(3,4,5-trihydroxybenzoyl)oxymethyl]oxan-3-yl] 2-[[31-(1,1-dihydroxy-2-oxobut-3-enyl)-14,15,18,19,20,31,34,35-octahydroxy-2,10,23,28-tetraoxo-5-(3,4,5-trihydroxybenzoyl)oxy-3,6,9,24,27,32-hexaoxaheptacyclo[28.6.1.04,25.07,26.011,16.017,22.033,37]heptatriaconta-1(36),11,13,15,17,19,21,33(37),34-nonaen-13-yl]oxy]-3,4,5-trihydroxybenzoate](https://plantaedb.com/storage/docs/compounds/2023/11/97f33930-86de-11ee-bf9b-fb5b8c7bfafa.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.45% | 91.11% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 98.88% | 83.00% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 98.73% | 95.17% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 98.42% | 91.49% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 94.57% | 97.21% |
CHEMBL2581 | P07339 | Cathepsin D | 94.08% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.71% | 86.33% |
CHEMBL220 | P22303 | Acetylcholinesterase | 93.22% | 94.45% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.86% | 89.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 91.98% | 96.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.14% | 99.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.09% | 95.56% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.64% | 95.89% |
CHEMBL4530 | P00488 | Coagulation factor XIII | 88.16% | 96.00% |
CHEMBL1902 | P62942 | FK506-binding protein 1A | 87.84% | 97.05% |
CHEMBL4208 | P20618 | Proteasome component C5 | 87.80% | 90.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.42% | 94.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.67% | 97.09% |
CHEMBL3891 | P07384 | Calpain 1 | 85.36% | 93.04% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 84.28% | 92.50% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 84.20% | 89.34% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.09% | 91.19% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.81% | 96.09% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.79% | 95.50% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 83.72% | 80.78% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.51% | 94.73% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.85% | 99.23% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 82.53% | 96.90% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 81.65% | 96.38% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.22% | 92.62% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 80.81% | 96.00% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 80.75% | 95.64% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.72% | 100.00% |
CHEMBL3194 | P02766 | Transthyretin | 80.32% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Euphorbia maculata |
PubChem | 163040510 |
LOTUS | LTS0196688 |
wikiData | Q105001162 |