5-hydroxy-5-[(2R)-2-[(3R,5R,10S,13R,14S)-3-hydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]-3-methylfuran-2-one
| Internal ID | aabb5096-c04d-49f8-b699-ffac3b9d16a6 |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroid lactones > Withanolides and derivatives |
| IUPAC Name | 5-hydroxy-5-[(2R)-2-[(3R,5R,10S,13R,14S)-3-hydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]-3-methylfuran-2-one |
| SMILES (Canonical) | CC1=CC(OC1=O)(CC(C)C2=CCC3(C2(CCC4=C3CCC5C4(CCC(C5(C)C)O)C)C)C)O |
| SMILES (Isomeric) | CC1=CC(OC1=O)(C[C@@H](C)C2=CC[C@@]3([C@@]2(CCC4=C3CC[C@@H]5[C@@]4(CC[C@H](C5(C)C)O)C)C)C)O |
| InChI | InChI=1S/C30H44O4/c1-18(16-30(33)17-19(2)25(32)34-30)20-10-14-29(7)22-8-9-23-26(3,4)24(31)12-13-27(23,5)21(22)11-15-28(20,29)6/h10,17-18,23-24,31,33H,8-9,11-16H2,1-7H3/t18-,23+,24-,27-,28-,29+,30?/m1/s1 |
| InChI Key | UHKHABIIDWFZIO-AVJQBXPLSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C30H44O4 |
| Molecular Weight | 468.70 g/mol |
| Exact Mass | 468.32395988 g/mol |
| Topological Polar Surface Area (TPSA) | 66.80 Ų |
| XlogP | 5.50 |
| There are no found synonyms. |
![2D Structure of 5-hydroxy-5-[(2R)-2-[(3R,5R,10S,13R,14S)-3-hydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]-3-methylfuran-2-one](https://plantaedb.com/storage/docs/compounds/2023/11/97f30620-8558-11ee-8a28-b17fe5ebb7f7.jpg "2D Structure of 5-hydroxy-5-[(2R)-2-[(3R,5R,10S,13R,14S)-3-hydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]-3-methylfuran-2-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.75% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.04% | 98.95% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.03% | 97.25% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.05% | 95.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.82% | 97.09% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.90% | 100.00% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 87.29% | 95.93% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 87.01% | 93.99% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 86.45% | 94.75% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.19% | 95.89% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 86.11% | 96.61% |
| CHEMBL1871 | P10275 | Androgen Receptor | 84.01% | 96.43% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 83.17% | 90.24% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 83.12% | 90.08% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.22% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.83% | 94.45% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 81.80% | 90.17% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.18% | 93.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Abies chensiensis |
| PubChem | 44179576 |
| LOTUS | LTS0205425 |
| wikiData | Q105337859 |