[(1S,2S,4S,5S,6S,7S)-5-hydroxy-7-(3-methylbutanoyloxy)-10-[[(2S,3S,4R,5R,6S)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxymethyl]-3,8-dioxatricyclo[4.4.0.02,4]dec-9-en-5-yl]methyl 3-methylbutanoate
| Internal ID | cd5edb61-7344-4e32-be67-cfc77cae68bc |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > O-glycosyl compounds |
| IUPAC Name | [(1S,2S,4S,5S,6S,7S)-5-hydroxy-7-(3-methylbutanoyloxy)-10-[[(2S,3S,4R,5R,6S)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxymethyl]-3,8-dioxatricyclo[4.4.0.02,4]dec-9-en-5-yl]methyl 3-methylbutanoate |
| SMILES (Canonical) | CC(C)CC(=O)OCC1(C2C(C3C1O3)C(=COC2OC(=O)CC(C)C)COC4C(C(C(C(O4)COC5C(C(C(C(O5)CO)O)O)O)O)O)O)O |
| SMILES (Isomeric) | CC(C)CC(=O)OC[C@]1([C@@H]2[C@H]([C@H]3[C@@H]1O3)C(=CO[C@H]2OC(=O)CC(C)C)CO[C@@H]4[C@H]([C@@H]([C@H]([C@@H](O4)CO[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)O)O)O)O |
| InChI | InChI=1S/C32H50O18/c1-12(2)5-17(34)46-11-32(42)20-19(27-28(32)50-27)14(8-43-29(20)49-18(35)6-13(3)4)9-44-30-26(41)24(39)22(37)16(48-30)10-45-31-25(40)23(38)21(36)15(7-33)47-31/h8,12-13,15-16,19-31,33,36-42H,5-7,9-11H2,1-4H3/t15-,16+,19-,20-,21-,22+,23+,24-,25-,26+,27+,28+,29+,30+,31-,32-/m1/s1 |
| InChI Key | NGYOKRAMXZLLQJ-FXNOOZBWSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C32H50O18 |
| Molecular Weight | 722.70 g/mol |
| Exact Mass | 722.29971474 g/mol |
| Topological Polar Surface Area (TPSA) | 273.00 Ų |
| XlogP | -3.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.41% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.06% | 91.11% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 93.66% | 95.93% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.46% | 98.95% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.97% | 97.25% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 88.20% | 96.47% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.96% | 94.73% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.80% | 97.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.64% | 99.17% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.46% | 96.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.24% | 86.33% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.12% | 89.00% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 82.53% | 92.32% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 81.96% | 90.17% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.74% | 92.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Valeriana officinalis |
| PubChem | 163000368 |
| LOTUS | LTS0217417 |
| wikiData | Q105179239 |