(2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[(3S,5Z)-6-[(2R,5S)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-3-methylhexa-1,5-dien-3-yl]oxyoxane-3,4,5-triol
| Internal ID | 5e5ff134-6894-45bb-be23-663eae346169 |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty acyl glycosides > Fatty acyl glycosides of mono- and disaccharides |
| IUPAC Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[(3S,5Z)-6-[(2R,5S)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-3-methylhexa-1,5-dien-3-yl]oxyoxane-3,4,5-triol |
| SMILES (Canonical) | CC1(CCC(O1)C(C)(C)O)C=CCC(C)(C=C)OC2C(C(C(C(O2)CO)O)O)O |
| SMILES (Isomeric) | C[C@@]1(CC[C@H](O1)C(C)(C)O)/C=C\C[C@@](C)(C=C)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O |
| InChI | InChI=1S/C21H36O8/c1-6-20(4,29-18-17(25)16(24)15(23)13(12-22)27-18)9-7-10-21(5)11-8-14(28-21)19(2,3)26/h6-7,10,13-18,22-26H,1,8-9,11-12H2,2-5H3/b10-7-/t13-,14+,15-,16+,17-,18+,20-,21+/m1/s1 |
| InChI Key | QRGRNEUSNHIAOU-SOHRVHQUSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C21H36O8 |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.24101810 g/mol |
| Topological Polar Surface Area (TPSA) | 129.00 Ų |
| XlogP | 0.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.55% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.43% | 91.11% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 96.12% | 96.61% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.03% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.09% | 97.09% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 90.17% | 97.47% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 89.92% | 96.21% |
| CHEMBL1977 | P11473 | Vitamin D receptor | 87.52% | 99.43% |
| CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 87.27% | 100.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.39% | 95.89% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 86.19% | 95.38% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 85.19% | 95.93% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 85.18% | 98.10% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 85.06% | 96.77% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 83.43% | 95.50% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.91% | 92.62% |
| CHEMBL3589 | P55263 | Adenosine kinase | 82.52% | 98.05% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 81.72% | 94.75% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.72% | 100.00% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 80.99% | 91.03% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 80.93% | 94.73% |
| CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 80.60% | 92.78% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 80.57% | 95.71% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.17% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163073852 |
| LOTUS | LTS0066809 |
| wikiData | Q105226288 |