(3S,4aS,4bS,8R,8aS,10aR)-3-hydroxy-1,1,4a,8-tetramethyl-7-vinyl-1,3,4,4a,4b,8,8a,9,10,10a-decahydrophenanthrene-2,5-dione
Internal ID | f343044f-7959-4498-b80d-973ab7976e91 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Isocopalane and spongiane diterpenoids |
IUPAC Name | (3R,4aR,4bR,8S,10aS)-7-ethenyl-3-hydroxy-1,1,4a,8-tetramethyl-3,4,4b,8,8a,9,10,10a-octahydrophenanthrene-2,5-dione |
SMILES (Canonical) | CC1C2CCC3C(C(=O)C(CC3(C2C(=O)C=C1C=C)C)O)(C)C |
SMILES (Isomeric) | C[C@H]1C2CC[C@H]3[C@]([C@@H]2C(=O)C=C1C=C)(C[C@H](C(=O)C3(C)C)O)C |
InChI | InChI=1S/C20H28O3/c1-6-12-9-14(21)17-13(11(12)2)7-8-16-19(3,4)18(23)15(22)10-20(16,17)5/h6,9,11,13,15-17,22H,1,7-8,10H2,2-5H3/t11-,13?,15-,16-,17+,20-/m1/s1 |
InChI Key | XVEOIKIXOSKAFL-HLVXAQHSSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H28O3 |
Molecular Weight | 316.40 g/mol |
Exact Mass | 316.20384475 g/mol |
Topological Polar Surface Area (TPSA) | 54.40 Ų |
XlogP | 3.40 |
2beta-hydroxy-12,15-cassadiene-3,11-dione |
(3S,4aS,4bS,8R,8aS,10aR)-3-hydroxy-1,1,4a,8-tetramethyl-7-vinyl-1,3,4,4a,4b,8,8a,9,10,10a-decahydrophenanthrene-2,5-dione |
(2beta,14alpha)-2-hydroxy-14-methyl-13-vinylpodocarp-12-ene-3,11-dione |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.72% | 91.11% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 94.03% | 90.17% |
CHEMBL2581 | P07339 | Cathepsin D | 92.01% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.83% | 96.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.27% | 100.00% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 88.88% | 94.75% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.83% | 95.56% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 86.39% | 94.78% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.97% | 97.09% |
CHEMBL4530 | P00488 | Coagulation factor XIII | 82.94% | 96.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.84% | 97.25% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.35% | 89.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.23% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Oryza sativa |
PubChem | 131841560 |
LOTUS | LTS0023822 |
wikiData | Q105342816 |