[(2R,3S,4S,5R,6R)-6-[[(3S,8S,9S,10R,13R,14S,17R)-17-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-3,4,5-trihydroxyoxan-2-yl]methyl (9Z,12Z,15Z)-octadeca-9,12,15-trienoate
Internal ID | 82b5e47e-a536-4f66-80f8-10afe8682a63 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Stigmastanes and derivatives |
IUPAC Name | [(2R,3S,4S,5R,6R)-6-[[(3S,8S,9S,10R,13R,14S,17R)-17-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-3,4,5-trihydroxyoxan-2-yl]methyl (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
SMILES (Canonical) | CCC=CCC=CCC=CCCCCCCCC(=O)OCC1C(C(C(C(O1)OC2CCC3(C4CCC5(C(C4CC=C3C2)CCC5C(C)CCC(CC)C(C)C)C)C)O)O)O |
SMILES (Isomeric) | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O[C@H]2CC[C@@]3([C@H]4CC[C@]5([C@H]([C@@H]4CC=C3C2)CC[C@@H]5[C@H](C)CC[C@@H](CC)C(C)C)C)C)O)O)O |
InChI | InChI=1S/C53H88O7/c1-8-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-47(54)58-36-46-48(55)49(56)50(57)51(60-46)59-41-31-33-52(6)40(35-41)27-28-42-44-30-29-43(53(44,7)34-32-45(42)52)38(5)25-26-39(9-2)37(3)4/h10-11,13-14,16-17,27,37-39,41-46,48-51,55-57H,8-9,12,15,18-26,28-36H2,1-7H3/b11-10-,14-13-,17-16-/t38-,39-,41+,42+,43-,44+,45+,46-,48-,49+,50-,51-,52+,53-/m1/s1 |
InChI Key | BYFNXTURFRVSSA-MRUMRNDKSA-N |
Popularity | 0 references in papers |
Molecular Formula | C53H88O7 |
Molecular Weight | 837.30 g/mol |
Exact Mass | 836.65300514 g/mol |
Topological Polar Surface Area (TPSA) | 105.00 Ų |
XlogP | 13.90 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL220 | P22303 | Acetylcholinesterase | 99.61% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.90% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 98.06% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.69% | 91.11% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 97.46% | 99.17% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.35% | 94.45% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 93.06% | 92.50% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 93.04% | 93.56% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 92.32% | 100.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.81% | 97.25% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 91.65% | 95.89% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.54% | 89.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.54% | 97.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.85% | 100.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.89% | 86.33% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 89.47% | 96.47% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.04% | 95.89% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.94% | 90.71% |
CHEMBL1871 | P10275 | Androgen Receptor | 85.37% | 96.43% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 85.17% | 89.62% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 85.07% | 85.31% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 85.06% | 95.93% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.97% | 96.00% |
CHEMBL5028 | O14672 | ADAM10 | 83.37% | 97.50% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.35% | 94.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.13% | 95.56% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 82.83% | 94.75% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 82.16% | 96.38% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 81.85% | 90.17% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 81.52% | 97.50% |
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 80.29% | 85.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Capsicum annuum |
Cremanthodium discoideum |
Edgeworthia chrysantha |
Euphorbia petiolata |
PubChem | 101609199 |
LOTUS | LTS0194229 |
wikiData | Q104949195 |