9,12-Epoxy-1H-diindolo[1,2,3-fg:3',2',1'-kl]pyrrolo[3,4-i][1,6]benzodiazocine-10-carboxylicacid, 2,3,9,10,11,12-hexahydro-10-hydroxy-9-methyl-1-oxo-, (9S,10R,12R)-
| Internal ID | d06d7984-6551-4cbb-b41b-fe79a18c4c71 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles > Pyrrolocarbazoles > Indolocarbazoles |
| IUPAC Name | (15S,16R,18R)-16-hydroxy-15-methyl-3-oxo-28-oxa-4,14,19-triazaoctacyclo[12.11.2.115,18.02,6.07,27.08,13.019,26.020,25]octacosa-1,6,8,10,12,20,22,24,26-nonaene-16-carboxylic acid |
| SMILES (Canonical) | CC12C(CC(O1)N3C4=CC=CC=C4C5=C6C(=C7C8=CC=CC=C8N2C7=C53)CNC6=O)(C(=O)O)O |
| SMILES (Isomeric) | C[C@@]12[C@](C[C@@H](O1)N3C4=CC=CC=C4C5=C6C(=C7C8=CC=CC=C8N2C7=C53)CNC6=O)(C(=O)O)O |
| InChI | InChI=1S/C26H19N3O5/c1-25-26(33,24(31)32)10-17(34-25)28-15-8-4-2-6-12(15)19-20-14(11-27-23(20)30)18-13-7-3-5-9-16(13)29(25)22(18)21(19)28/h2-9,17,33H,10-11H2,1H3,(H,27,30)(H,31,32)/t17-,25+,26+/m1/s1 |
| InChI Key | AMSOPBXQXSAAAC-PLZPTFKGSA-N |
| Popularity | 726 references in papers |
| Molecular Formula | C26H19N3O5 |
| Molecular Weight | 453.40 g/mol |
| Exact Mass | 453.13247072 g/mol |
| Topological Polar Surface Area (TPSA) | 106.00 Ų |
| XlogP | 2.40 |
| Atomic LogP (AlogP) | 3.57 |
| H-Bond Acceptor | 6 |
| H-Bond Donor | 3 |
| Rotatable Bonds | 1 |
| k-252b |
| 9,12-Epoxy-1H-diindolo[1,2,3-fg:3',2',1'-kl]pyrrolo[3,4-i][1,6]benzodiazocine-10-carboxylicacid, 2,3,9,10,11,12-hexahydro-10-hydroxy-9-methyl-1-oxo-, (9S,10R,12R)- |
| CHEMBL4750633 |
| (15S,16R,18R)-16-Hydroxy-15-methyl-3-oxo-28-oxa-4,14,19-triazaoctacyclo[12.11.2.115,18.02,6.07,27.08,13.019,26.020,25]octacosa-1,6,8,10,12,20,22,24,26-nonaene-16-carboxylic acid |
| K252b |
| DTXSID90433626 |
| HY-N6734 |
| BDBM50547746 |
| AKOS030254879 |
| AS-78713 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.7443 | 74.43% |
| Caco-2 | - | 0.8366 | 83.66% |
| Blood Brain Barrier | - | 0.7750 | 77.50% |
| Human oral bioavailability | + | 0.5857 | 58.57% |
| Subcellular localzation | Lysosomes | 0.4865 | 48.65% |
| OATP2B1 inhibitior | - | 0.8592 | 85.92% |
| OATP1B1 inhibitior | + | 0.8970 | 89.70% |
| OATP1B3 inhibitior | + | 0.9389 | 93.89% |
| MATE1 inhibitior | - | 0.9000 | 90.00% |
| OCT2 inhibitior | - | 0.9566 | 95.66% |
| BSEP inhibitior | + | 0.9110 | 91.10% |
| P-glycoprotein inhibitior | - | 0.6118 | 61.18% |
| P-glycoprotein substrate | + | 0.7653 | 76.53% |
| CYP3A4 substrate | + | 0.6483 | 64.83% |
| CYP2C9 substrate | - | 0.6157 | 61.57% |
| CYP2D6 substrate | - | 0.8939 | 89.39% |
| CYP3A4 inhibition | - | 0.7871 | 78.71% |
| CYP2C9 inhibition | - | 0.7394 | 73.94% |
| CYP2C19 inhibition | - | 0.7721 | 77.21% |
| CYP2D6 inhibition | - | 0.9087 | 90.87% |
| CYP1A2 inhibition | - | 0.7520 | 75.20% |
| CYP2C8 inhibition | + | 0.5985 | 59.85% |
| CYP inhibitory promiscuity | - | 0.8030 | 80.30% |
| UGT catelyzed | - | 0.7000 | 70.00% |
| Carcinogenicity (binary) | - | 0.8500 | 85.00% |
| Carcinogenicity (trinary) | Non-required | 0.5890 | 58.90% |
| Eye corrosion | - | 0.9900 | 99.00% |
| Eye irritation | - | 0.9616 | 96.16% |
| Skin irritation | - | 0.7844 | 78.44% |
| Skin corrosion | - | 0.9364 | 93.64% |
| Ames mutagenesis | + | 0.5082 | 50.82% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.6140 | 61.40% |
| Micronuclear | + | 0.8000 | 80.00% |
| Hepatotoxicity | + | 0.7003 | 70.03% |
| skin sensitisation | - | 0.8644 | 86.44% |
| Respiratory toxicity | + | 0.8444 | 84.44% |
| Reproductive toxicity | + | 0.9778 | 97.78% |
| Mitochondrial toxicity | + | 0.8625 | 86.25% |
| Nephrotoxicity | - | 0.5825 | 58.25% |
| Acute Oral Toxicity (c) | III | 0.5389 | 53.89% |
| Estrogen receptor binding | + | 0.7920 | 79.20% |
| Androgen receptor binding | + | 0.6837 | 68.37% |
| Thyroid receptor binding | + | 0.5532 | 55.32% |
| Glucocorticoid receptor binding | + | 0.7307 | 73.07% |
| Aromatase binding | + | 0.7720 | 77.20% |
| PPAR gamma | + | 0.8012 | 80.12% |
| Honey bee toxicity | - | 0.8855 | 88.55% |
| Biodegradation | - | 0.9250 | 92.50% |
| Crustacea aquatic toxicity | - | 0.6200 | 62.00% |
| Fish aquatic toxicity | + | 0.7038 | 70.38% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 99.51% | 85.14% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.55% | 91.11% |
| CHEMBL2815 | P04629 | Nerve growth factor receptor Trk-A | 98.54% | 87.16% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 98.31% | 80.71% |
| CHEMBL2708 | Q16584 | Mitogen-activated protein kinase kinase kinase 11 | 97.89% | 81.14% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.15% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.77% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.62% | 95.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.57% | 89.00% |
| CHEMBL5600 | P27448 | Serine/threonine-protein kinase c-TAK1 | 96.11% | 88.81% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 95.66% | 91.79% |
| CHEMBL4924 | Q9UK32 | Ribosomal protein S6 kinase alpha 6 | 95.49% | 80.00% |
| CHEMBL1974 | P36888 | Tyrosine-protein kinase receptor FLT3 | 95.17% | 91.83% |
| CHEMBL2964 | P36507 | Dual specificity mitogen-activated protein kinase kinase 2 | 95.10% | 80.00% |
| CHEMBL2801 | Q13557 | CaM kinase II delta | 94.99% | 84.49% |
| CHEMBL3788 | O00444 | Serine/threonine-protein kinase PLK4 | 94.09% | 83.65% |
| CHEMBL5284 | Q96RR4 | CaM-kinase kinase beta | 93.77% | 89.23% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 93.71% | 85.11% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 92.64% | 83.10% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.92% | 98.95% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 91.51% | 93.99% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.17% | 99.23% |
| CHEMBL5408 | Q9UHD2 | Serine/threonine-protein kinase TBK1 | 90.82% | 90.48% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 90.39% | 85.30% |
| CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 90.19% | 96.47% |
| CHEMBL4598 | Q13043 | Serine/threonine-protein kinase MST1 | 89.06% | 96.64% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 88.35% | 93.03% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.32% | 86.33% |
| CHEMBL5285 | Q99683 | Mitogen-activated protein kinase kinase kinase 5 | 87.88% | 92.26% |
| CHEMBL4599 | Q07912 | Tyrosine kinase non-receptor protein 2 | 87.51% | 94.29% |
| CHEMBL4578 | Q14680 | Maternal embryonic leucine zipper kinase | 87.35% | 81.58% |
| CHEMBL4482 | O96013 | Serine/threonine-protein kinase PAK 4 | 86.93% | 95.42% |
| CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 86.68% | 90.95% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.33% | 90.17% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 86.26% | 93.00% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 84.29% | 90.08% |
| CHEMBL5678 | P34947 | G protein-coupled receptor kinase 5 | 84.26% | 88.00% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 83.65% | 96.00% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 83.14% | 94.62% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 82.84% | 98.59% |
| CHEMBL4237 | O75582 | Ribosomal protein S6 kinase alpha 5 | 82.39% | 91.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.37% | 95.89% |
| CHEMBL5314 | Q06418 | Tyrosine-protein kinase receptor TYRO3 | 80.50% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 9981344 |
| LOTUS | LTS0151419 |
| wikiData | Q82247820 |