(3,6,9-Trimethylidene-2-oxo-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-8-yl) 2-amino-3-methylbutanoate
| Internal ID | 1fba1308-ca6d-4911-9cff-38fdec841820 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Sesquiterpene lactones > Guaianolides and derivatives |
| IUPAC Name | (3,6,9-trimethylidene-2-oxo-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-8-yl) 2-amino-3-methylbutanoate |
| SMILES (Canonical) | CC(C)C(C(=O)OC1CC2C(C1=C)C3C(CCC2=C)C(=C)C(=O)O3)N |
| SMILES (Isomeric) | CC(C)C(C(=O)OC1CC2C(C1=C)C3C(CCC2=C)C(=C)C(=O)O3)N |
| InChI | InChI=1S/C20H27NO4/c1-9(2)17(21)20(23)24-15-8-14-10(3)6-7-13-11(4)19(22)25-18(13)16(14)12(15)5/h9,13-18H,3-8,21H2,1-2H3 |
| InChI Key | MYWGORCHPZQEOA-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.19400834 g/mol |
| Topological Polar Surface Area (TPSA) | 78.60 Ų |
| XlogP | 2.40 |
| There are no found synonyms. |
![2D Structure of (3,6,9-Trimethylidene-2-oxo-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-8-yl) 2-amino-3-methylbutanoate](https://plantaedb.com/storage/docs/compounds/2023/11/957431f0-8620-11ee-b64d-598a41f70f8e.jpg "2D Structure of (3,6,9-Trimethylidene-2-oxo-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-8-yl) 2-amino-3-methylbutanoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.48% | 97.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.53% | 97.25% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.82% | 94.45% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 92.72% | 97.79% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.17% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.47% | 95.56% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 86.20% | 96.47% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.51% | 99.23% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 84.50% | 95.58% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 84.37% | 93.56% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.29% | 95.89% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.85% | 91.19% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 83.66% | 98.03% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.55% | 96.09% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 83.20% | 95.93% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 81.07% | 91.49% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 80.69% | 95.71% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 80.30% | 93.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Fitchia speciosa |
| PubChem | 162963279 |
| LOTUS | LTS0202712 |
| wikiData | Q105175231 |