[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[[(1S,2R,4S,6R,10S)-6-hydroxy-2-methyl-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-10-yl]oxy]oxan-3-yl] (Z)-3-(4-hydroxyphenyl)prop-2-enoate
Internal ID | 69a991d3-6e6c-4e5e-acbb-58a633adba9a |
Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Hydroxycinnamic acids and derivatives > Hydroxycinnamic acid esters > Coumaric acid esters |
IUPAC Name | [(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[[(1S,2R,4S,6R,10S)-6-hydroxy-2-methyl-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-10-yl]oxy]oxan-3-yl] (Z)-3-(4-hydroxyphenyl)prop-2-enoate |
SMILES (Canonical) | CC12C(O1)CC3(C2C(OC=C3)OC4C(C(C(C(O4)CO)O)O)OC(=O)C=CC5=CC=C(C=C5)O)O |
SMILES (Isomeric) | C[C@@]12[C@@H](O1)C[C@@]3([C@@H]2[C@@H](OC=C3)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)OC(=O)/C=C\C5=CC=C(C=C5)O)O |
InChI | InChI=1S/C24H28O11/c1-23-15(35-23)10-24(30)8-9-31-22(20(23)24)34-21-19(18(29)17(28)14(11-25)32-21)33-16(27)7-4-12-2-5-13(26)6-3-12/h2-9,14-15,17-22,25-26,28-30H,10-11H2,1H3/b7-4-/t14-,15+,17-,18+,19-,20-,21+,22+,23+,24+/m1/s1 |
InChI Key | DUSNEDXMOOGSOE-CMSDINTISA-N |
Popularity | 0 references in papers |
Molecular Formula | C24H28O11 |
Molecular Weight | 492.50 g/mol |
Exact Mass | 492.16316171 g/mol |
Topological Polar Surface Area (TPSA) | 168.00 Ų |
XlogP | 0.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.01% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.96% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.27% | 94.45% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.91% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.75% | 86.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.21% | 97.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 91.84% | 96.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.66% | 95.56% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 87.74% | 95.93% |
CHEMBL4208 | P20618 | Proteasome component C5 | 86.80% | 90.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.18% | 94.73% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 85.92% | 97.79% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 85.87% | 97.28% |
CHEMBL206 | P03372 | Estrogen receptor alpha | 85.29% | 97.64% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.92% | 100.00% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 84.51% | 93.10% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.98% | 99.17% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 83.87% | 89.67% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 83.29% | 90.17% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 82.64% | 91.49% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.56% | 92.50% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.51% | 95.89% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.33% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ajuga decumbens |
PubChem | 162982065 |
LOTUS | LTS0130495 |
wikiData | Q104989399 |