(6S,7R,8R)-6,8-bis(2,4-dihydroxyphenyl)-7-(3,5-dihydroxyphenyl)-5,6,7,8-tetrahydronaphthalene-1,3-diol
Internal ID | bfec06e6-0dc8-4b0d-9e28-b05088f60bed |
Taxonomy | Lignans, neolignans and related compounds > Aryltetralin lignans |
IUPAC Name | (6S,7R,8R)-6,8-bis(2,4-dihydroxyphenyl)-7-(3,5-dihydroxyphenyl)-5,6,7,8-tetrahydronaphthalene-1,3-diol |
SMILES (Canonical) | C1C(C(C(C2=C1C=C(C=C2O)O)C3=C(C=C(C=C3)O)O)C4=CC(=CC(=C4)O)O)C5=C(C=C(C=C5)O)O |
SMILES (Isomeric) | C1[C@@H]([C@H]([C@@H](C2=C1C=C(C=C2O)O)C3=C(C=C(C=C3)O)O)C4=CC(=CC(=C4)O)O)C5=C(C=C(C=C5)O)O |
InChI | InChI=1S/C28H24O8/c29-15-1-3-20(23(34)10-15)22-8-14-7-19(33)12-25(36)27(14)28(21-4-2-16(30)11-24(21)35)26(22)13-5-17(31)9-18(32)6-13/h1-7,9-12,22,26,28-36H,8H2/t22-,26-,28+/m1/s1 |
InChI Key | QQGGCAFWTCETPD-QIDLSXJSSA-N |
Popularity | 0 references in papers |
Molecular Formula | C28H24O8 |
Molecular Weight | 488.50 g/mol |
Exact Mass | 488.14711772 g/mol |
Topological Polar Surface Area (TPSA) | 162.00 Ų |
XlogP | 4.30 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.65% | 91.11% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 94.28% | 95.62% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 93.83% | 91.49% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.24% | 96.09% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 90.78% | 93.40% |
CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 90.54% | 91.79% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 90.22% | 96.12% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.43% | 97.09% |
CHEMBL2581 | P07339 | Cathepsin D | 87.99% | 98.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.67% | 95.89% |
CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 86.93% | 97.23% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.34% | 99.15% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 85.13% | 89.62% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 84.95% | 91.00% |
CHEMBL3194 | P02766 | Transthyretin | 84.60% | 90.71% |
CHEMBL238 | Q01959 | Dopamine transporter | 82.85% | 95.88% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 82.82% | 85.00% |
CHEMBL2073 | P07947 | Tyrosine-protein kinase YES | 82.51% | 83.14% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.93% | 90.71% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 81.33% | 100.00% |
CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 80.89% | 100.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.43% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Bagassa guianensis |
PubChem | 102048881 |
LOTUS | LTS0039795 |
wikiData | Q105225812 |